| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 8-Bromo-cadp-ribose Basic information |
| Product Name: | 8-Bromo-cadp-ribose | | Synonyms: | 8-BR-CADPR;8-BROMO-CYCLIC ADENOSINE DIPHOSPHATE RIBOSE;BR-CADP-RIBOSE;Br-cADP-ribose, Br-cADPR;8-Bromocyclic adenosine diphosphate ribose sodium salt;Br-cADPR;8-Bromo-cADP-Ribose (8-Br-cADPR);Adenosine 5'-(trihydrogen diphosphate), 8-bromo-1-β-D-ribofuranosyl-, intramol. P',5''-ester | | CAS: | 151898-26-9 | | MF: | C15H20BrN5O13P2 | | MW: | 620.2 | | EINECS: | | | Product Categories: | | | Mol File: | 151898-26-9.mol |  |
| | 8-Bromo-cadp-ribose Chemical Properties |
| Boiling point | 941.8±75.0 °C(Predicted) | | density | 2.78±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | H2O: 5 mg/mL | | form | lyophilized powder | | pka | 0.97±0.70(Predicted) | | color | white | | Water Solubility | H2O: 5mg/mL | | InChIKey | PLQQKRPSINJWTK-VNMBDIRDSA-N | | SMILES | Nc1ncnc2n([C@@H]3O[C@@H]4COP(O)(=O)OP(=O)(O[C@@H]5O[C@H](CO)[C@@H](O)[C@H]5O)O[C@H]4[C@H]3O)c(Br)nc12 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 8-Bromo-cadp-ribose Usage And Synthesis |
| Chemical Properties | white lyophilized powder | | Uses | 8-Br-cADPR is a potent cADPR antagonist. 8-Br-cADPR reduces renal damage and the expression of caspase-3 and TRPM2[1]. | | Biochem/physiol Actions | An antagonist of cyclic ADP-ribose (cADPR), and an endogenous metabolite of β-NAD+. cADPR has been shown to regulate calcium release from the endoplasmic and sarcoplasmic reticulum. In cells, cADPR is synthesized by ADP-ribosyl cyclase or CD38, a lymphocyte differentiation antigen. | | References | [1] Eraslan E, et al. 8-Br-cADPR, a TRPM2 ion channel antagonist, inhibits renal ischemia-reperfusion injury. J Cell Physiol. 2019 Apr;234(4):4572-4581. DOI:10.1002/jcp.27236 |
| | 8-Bromo-cadp-ribose Preparation Products And Raw materials |
|