|
|
| | 4-AMINO-5-BROMO-3-METHYLPYRIDINE Basic information |
| Product Name: | 4-AMINO-5-BROMO-3-METHYLPYRIDINE | | Synonyms: | 4-Amino-5-bromo-3-methylpyridine 95+%;4-AMINO-5-BROMO-3-METHYLPYRIDINE;4-AMINO-5-BROMO-3-PICOLINE;3-Bromo-5-methyl-4-pyridinamine;3-Bromo-5-methyl-pyridin-4-ylamine;4-Pyridinamine, 3-bromo-5-methyl-;4-AMINO-5-BROMO-3-METHYLPYRIDINE ISO 9001：2015 REACH;3-Bromo-5-methylpyridin-4-amine | | CAS: | 97944-43-9 | | MF: | C6H7BrN2 | | MW: | 187.04 | | EINECS: | | | Product Categories: | Pyridines;Pyridine | | Mol File: | 97944-43-9.mol |  |
| | 4-AMINO-5-BROMO-3-METHYLPYRIDINE Chemical Properties |
| Melting point | 115.0 °C | | Boiling point | 290.0±35.0 °C(Predicted) | | density | 1.593±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 7.34±0.24(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H7BrN2/c1-4-2-9-3-5(7)6(4)8/h2-3H,1H3,(H2,8,9) | | InChIKey | GUAFGBUKLIFASX-UHFFFAOYSA-N | | SMILES | C1=NC=C(C)C(N)=C1Br |
| | 4-AMINO-5-BROMO-3-METHYLPYRIDINE Usage And Synthesis |
| Synthesis | The general procedure for the synthesis of 3-methyl-4-amino-5-bromopyridine from 3-methyl-4-aminopyridine is as follows:
Step 1: To a solution of 4-amino-3-methylpyridine (97, 10 g, 0.092 mol) and hydrobromic acid (HBr, 50 mL) heated to 70 °C was slowly added 15% hydrogen peroxide (H2O2, 16 mL) over a period of 1 hour. The reaction mixture was continued to be stirred at 70 °C for 1 h. The reaction was subsequently quenched by pouring into ice (100 g). The pH of the reaction mixture was adjusted to about 5 with 50% sodium hydroxide (NaOH) solution and the resulting red precipitate was collected by filtration. Subsequently, the pH of the filtrate was adjusted to about 9 and the resulting white precipitate was collected by filtration to afford 3-methyl-4-amino-5-bromopyridine (98, 13.5 g, 78% yield). | | References | [1] Patent: WO2005/16892, 2005, A1. Location in patent: Page/Page column 104
[2] Journal fuer Praktische Chemie (Leipzig), 1989, vol. 331, # 3, p. 369 - 374
[3] Patent: US2013/5705, 2013, A1 |
| | 4-AMINO-5-BROMO-3-METHYLPYRIDINE Preparation Products And Raw materials |
|