4-Nitrophenyl-beta-L-fucopyranoside manufacturers
|
| | 4-Nitrophenyl-beta-L-fucopyranoside Basic information |
| Product Name: | 4-Nitrophenyl-beta-L-fucopyranoside | | Synonyms: | 4-nitrophenyl6-deoxy-beta-l-galactopyranosid;PNP-BETA-L-FUC;(2S,3S,4R,5S,6R)-2-METHYL-6-(4-NITROPHENOXY)OXANE-3,4,5-TRIOL;PNP BETA-L-FUCOPYRANOSIDE;P-NITROPHENYL BETA-L-FUCOPYRANOSIDE;P-NITROPHENYL-BETA-L-FUCOSIDE;NITROPHENYL-B-L-FUCOPYRANOSIDE, 4-;4-NITROPHENYL-BETA-L-FUCOSIDE | | CAS: | 22153-71-5 | | MF: | C12H15NO7 | | MW: | 285.25 | | EINECS: | 244-808-3 | | Product Categories: | substrate;Substrates | | Mol File: | 22153-71-5.mol |  |
| | 4-Nitrophenyl-beta-L-fucopyranoside Chemical Properties |
| Boiling point | 515.4±50.0 °C(Predicted) | | density | 1.503±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 12.68±0.70(Predicted) | | InChI | InChI=1/C12H15NO7/c1-6-9(14)10(15)11(16)12(19-6)20-8-4-2-7(3-5-8)13(17)18/h2-6,9-12,14-16H,1H3/t6-,9+,10+,11-,12+/s3 | | InChIKey | YILIDCGSXCGACV-UAQQRRQCNA-N | | SMILES | [C@@H]1(O[C@H]([C@@H](O)[C@@H](O)[C@@H]1O)C)OC1=CC=C([N+]([O-])=O)C=C1 |&1:0,2,3,5,7,r| | | CAS DataBase Reference | 22153-71-5(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 29400090 |
| | 4-Nitrophenyl-beta-L-fucopyranoside Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | 4-Nitrophenyl beta-L-Fucopyranoside is a chromogenic substrate for β-D-Fucosidase, producing a yellow solution upon cleavage. | | Definition | ChEBI: A beta-L-fucoside that is beta-L-fucopyranose in which the anomeric hydroxy hydrogen is replaced by a 4-nitrophenyl group. |
| | 4-Nitrophenyl-beta-L-fucopyranoside Preparation Products And Raw materials |
|