4-Nitrophenyl-beta-D-fucopyranoside manufacturers
|
| | 4-Nitrophenyl-beta-D-fucopyranoside Basic information |
| | 4-Nitrophenyl-beta-D-fucopyranoside Chemical Properties |
| Melting point | 191-192 °C | | Boiling point | 515.4±50.0 °C(Predicted) | | density | 1.503±0.06 g/cm3(Predicted) | | refractive index | -75 ° (C=1, EtOH) | | storage temp. | Sealed in dry,2-8°C | | solubility | ethanol: soluble 25 mg/mL, clear, colorless to faintly yellow | | form | powder to crystal | | pka | 12.68±0.70(Predicted) | | color | White to Almost white | | BRN | 1291394 | | InChI | 1S/C12H15NO7/c1-6-9(14)10(15)11(16)12(19-6)20-8-4-2-7(3-5-8)13(17)18/h2-6,9-12,14-16H,1H3/t6-,9+,10+,11-,12+/m1/s1 | | InChIKey | YILIDCGSXCGACV-BVWHHUJWSA-N | | SMILES | C[C@H]1O[C@@H](Oc2ccc(cc2)[N+]([O-])=O)[C@H](O)[C@@H](O)[C@H]1O | | CAS DataBase Reference | 1226-39-7(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | F | 10 | | HS Code | 29329900 | | Storage Class | 11 - Combustible Solids |
| | 4-Nitrophenyl-beta-D-fucopyranoside Usage And Synthesis |
| Uses | 4-Nitrophenyl beta-D-Fucopyranoside (cas# 1226-39-7) is a compound useful in organic synthesis. |
| | 4-Nitrophenyl-beta-D-fucopyranoside Preparation Products And Raw materials |
|