|
|
| | Adrenalone hydrochloride Basic information |
| | Adrenalone hydrochloride Chemical Properties |
| Melting point | 244-249 °C (dec.) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | Off-White | | Water Solubility | almost transparency | | Merck | 14,171 | | BRN | 3916102 | | InChI | InChI=1S/C9H11NO3.ClH/c1-10-5-9(13)6-2-3-7(11)8(12)4-6;/h2-4,10-12H,5H2,1H3;1H | | InChIKey | CSRRBDMYOUQTCO-UHFFFAOYSA-N | | SMILES | C1(C(=O)CNC)=CC=C(O)C(O)=C1.Cl | | CAS DataBase Reference | 62-13-5(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | RTECS | AM8225000 | | F | 3-8-10-23 | | HS Code | 29225090 | | Storage Class | 11 - Combustible Solids |
| | Adrenalone hydrochloride Usage And Synthesis |
| Uses | adrenergic (opthalmic) | | Uses | Adrenalone displays antineoplastic activity and has been shown to inhibit growth of Ehrlich ascites tumors in mice. | | Preparation | Obtained by action of hydrochloric acid on 3,4-dihydroxy-a-methylaminoacetophenone (65%), in methanol. |
| | Adrenalone hydrochloride Preparation Products And Raw materials |
|