Hypoxanthine-9-beta-D-arabinofuranoside manufacturers
|
| | Hypoxanthine-9-beta-D-arabinofuranoside Basic information |
| Product Name: | Hypoxanthine-9-beta-D-arabinofuranoside | | Synonyms: | 9-beta-D-arabinofuranosyl-1,9-dihydro-6H-purin-6-one;ARABINOFURANOSYL-HYPOXANTHINE;9-β-D-Arabinofuranosyl hypoxanthine;9-(b-D-Arabinofuranosyl)hypoxanthine;Arabinosylhypoxanthine;hypoxanthine arabinoside;9-β-D-Arabinofuranosyl-1,9-dihydro-6H-purin-6-one;Ara-H | | CAS: | 7013-16-3 | | MF: | C10H12N4O5 | | MW: | 268.23 | | EINECS: | 230-295-3 | | Product Categories: | | | Mol File: | 7013-16-3.mol |  |
| | Hypoxanthine-9-beta-D-arabinofuranoside Chemical Properties |
| Melting point | 259-260 °C | | Boiling point | 797.9±60.0 °C(Predicted) | | density | 2.08±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | DMSO (Slightly), Water (Slightly) | | form | Solid | | pka | 8.92±0.70(Predicted) | | color | White to Off-White | | InChI | InChI=1/C10H12N4O5/c15-1-4-6(16)7(17)10(19-4)14-3-13-5-8(14)11-2-12-9(5)18/h2-4,6-7,10,15-17H,1H2,(H,11,12,18)/t4-,6-,7+,10-/s3 | | InChIKey | UGQMRVRMYYASKQ-GCTRTDOSNA-N | | SMILES | O[C@H]1[C@@H]([C@@H](CO)O[C@H]1N1C=NC2C(NC=NC1=2)=O)O |&1:1,2,3,7,r| |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29349990 |
| | Hypoxanthine-9-beta-D-arabinofuranoside Usage And Synthesis |
| Uses | Arainosine is used in the preparation of 5''-O-D-valyl adenine 9-β-D-arabinofuranoside, a potential prodrug for improving the oral bioavailability of the antiviral agent Vidarabine (V305030). |
| | Hypoxanthine-9-beta-D-arabinofuranoside Preparation Products And Raw materials |
|