N-ETHYL-N-(4-PICOLYL)ATROPAMIDE manufacturers
|
| | N-ETHYL-N-(4-PICOLYL)ATROPAMIDE Basic information |
| Product Name: | N-ETHYL-N-(4-PICOLYL)ATROPAMIDE | | Synonyms: | N-ETHYL-N-(4-PICOLYL)-2-PHENYLACRYLAMIDE;N-ETHYL-N-(4-PICOLYL)ATROPAMIDE;N-ETHYL-N-(4-PYRIDYLMETHYL)-2-PHENYLACRYLAMIDE;Apotropicamide;N-Ethyl-α-methylene-N-[(pyridin-4-yl)methyl]benzeneacetamide;N-Ethyl-N-(4-picolyl)-2-phenylacrylamide
N-Ethyl-N-(4-pyridylmethyl)-2-phenylacrylamide;TropicaMide Related CoMpound B;N-Ethyl-N-(4-picolyl)atropamide | | CAS: | 57322-50-6 | | MF: | C17H18N2O | | MW: | 266.34 | | EINECS: | | | Product Categories: | | | Mol File: | 57322-50-6.mol |  |
| | N-ETHYL-N-(4-PICOLYL)ATROPAMIDE Chemical Properties |
| storage temp. | Amber Vial, Refrigerator, Under inert atmosphere | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Oil | | color | Light Red to Very Dark Brown | | Stability: | Light Sensitive | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C17H18N2O/c1-3-19(13-15-9-11-18-12-10-15)17(20)14(2)16-7-5-4-6-8-16/h4-12H,2-3,13H2,1H3 | | InChIKey | LOVSQYAVWGMIRV-UHFFFAOYSA-N | | SMILES | N(CC)(Cc2ccncc2)C(=O)C(=C)c1ccccc1 |
| Risk Statements | 20/21/22 | | Safety Statements | 13-36/37/39 | | WGK Germany | WGK 3 | | HS Code | 2933399090 | | Storage Class | 10 - Combustible liquids |
| | N-ETHYL-N-(4-PICOLYL)ATROPAMIDE Usage And Synthesis |
| Uses | N-Ethyl-N-(4-picolyl)atropamide is a major impurity of Tropicamide (T892650), a medication used to dilate the pupil. |
| | N-ETHYL-N-(4-PICOLYL)ATROPAMIDE Preparation Products And Raw materials |
|