|
|
| | 3,4,5-Trimethoxyphenylacetic acid Basic information |
| Product Name: | 3,4,5-Trimethoxyphenylacetic acid | | Synonyms: | 3,4,5-Trimethoxybenzeneacetic acid;3,4,5-TriMethoxyphenylacetic acid, 99% 10GR;3,4,5-TRIMETHOXYPHENYL ACETIC ACID FOR S;(3,4,5-Trimethoxyphenyl)acetic acid, 2-(3,4,5-Trimethoxyphenyl)ethanoic acid;3,4,5-TriMethoxyphenylacetic Acid, 97+%;3,4,5-TrimethoxyphenyL;Three, four, five, three oxygen radicals phenylacetic acid;TriMethoxyphenylaceticaci | | CAS: | 951-82-6 | | MF: | C11H14O5 | | MW: | 226.23 | | EINECS: | 213-456-2 | | Product Categories: | Biochemics;C11 to C12;Carbonyl Compounds;Carboxylic Acids;Aromatic Phenylacetic Acids and Derivatives | | Mol File: | 951-82-6.mol |  |
| | 3,4,5-Trimethoxyphenylacetic acid Chemical Properties |
| Melting point | 117-120 °C (lit.) | | Boiling point | 327.83°C (rough estimate) | | density | 1.2668 (rough estimate) | | refractive index | 1.5140 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 4.23±0.10(Predicted) | | form | Crystalline Powder | | color | White to cream | | Water Solubility | SOLUBLE | | BRN | 2697844 | | InChI | InChI=1S/C11H14O5/c1-14-8-4-7(6-10(12)13)5-9(15-2)11(8)16-3/h4-5H,6H2,1-3H3,(H,12,13) | | InChIKey | DDSJXCGGOXKGSJ-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)=CC(OC)=C(OC)C(OC)=C1 | | CAS DataBase Reference | 951-82-6(CAS DataBase Reference) | | NIST Chemistry Reference | 3,4,5-Trimethoxyphenylacetic acid(951-82-6) |
| Hazard Codes | Xi | | Risk Statements | 38-36/37/38-22 | | Safety Statements | 22-24/25-37/39-26 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29189090 | | Storage Class | 11 - Combustible Solids |
| | 3,4,5-Trimethoxyphenylacetic acid Usage And Synthesis |
| Chemical Properties | white to cream-colored crystalline powder | | Uses | 3,4,5-Trimethoxyphenylacetic Acid is a reagent in the preparation of 3-phenylcoumarins as antidepressant agents. | | Definition | ChEBI: 2-(3,4,5-trimethoxyphenyl)acetic acid is a member of methoxybenzenes. |
| | 3,4,5-Trimethoxyphenylacetic acid Preparation Products And Raw materials |
|