| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | L-Phenylalanine (3-13C) Basic information |
| | L-Phenylalanine (3-13C) Chemical Properties |
| Melting point | 270-275 °C (dec.)(lit.) | | density | 1.202±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | form | Solid | | color | White to off-white | | Optical Rotation | [α]25/D -33.0°, c = 1 in H2O | | InChI | 1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1/i6+1 | | InChIKey | COLNVLDHVKWLRT-JCNVXSMLSA-N | | SMILES | N[C@@H]([13CH2]c1ccccc1)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-Phenylalanine (3-13C) Usage And Synthesis |
| Uses | L-Phenylalanine-3-13C is the 13C-labeled L-Phenylalanine. L-Phenylalanine ((S)-2-Amino-3-phenylpropionic acid) is an essential amino acid isolated from Escherichia coli. L-Phenylalanine is a α2δ subunit of voltage-dependent Ca+ channels antagonist with a Ki of 980 nM. L-phenylalanine is a competitive antagonist for the glycine- and glutamate-binding sites of N-methyl-D-aspartate receptors (NMDARs) (KB of 573 μM ) and non-NMDARs, respectively. L-Phenylalanine is widely used in the production of food flavors and pharmaceuticals[1][2][3][4]. | | IC 50 | NMDA Receptor | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. DOI:10.1177/1060028018797110 |
| | L-Phenylalanine (3-13C) Preparation Products And Raw materials |
|