| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 6,6-Dimethyl-5,7-dioxaspiro[2.5]octane-4,8-dione Basic information |
| Product Name: | 6,6-Dimethyl-5,7-dioxaspiro[2.5]octane-4,8-dione | | Synonyms: | CYCL-ISOPROPYLIDENE CYCLOPROPANE-1,1-DICARBOXYLATE;CYCLOPROPANE-1,1-DICARBOXYLIC ACID CYCL-ISOPROPYLIDENE ESTER;CYCLOPROPANE-1,1-DICARBOXYLIC ACID CYCLOISOPROPYLIDENE ESTER;1,1-Cyclopropanedicarboxylic acid cycl-isopropylidene ester~cycl-Isopropylidene 1,1-cyclopropanedicarboxylate;CYCLOPROPYL MELDRUM'S ACID;Danishefsky's reagent;CYCLOPROPANE-1,1-DICARBOXYLIC ACID CYCL-ISOPRYLIDENE ESTER;Cyclopropane-1,1-dicarboxylic acid cyclic-isopropylidene ester | | CAS: | 5617-70-9 | | MF: | C8H10O4 | | MW: | 170.16 | | EINECS: | 227-044-5 | | Product Categories: | Cyclopropanes;Dioxanes;Dioxanes & Dioxolanes;Simple 3-Membered Ring Compounds | | Mol File: | 5617-70-9.mol | ![6,6-Dimethyl-5,7-dioxaspiro[2.5]octane-4,8-dione Structure](CAS/GIF/5617-70-9.gif) |
| | 6,6-Dimethyl-5,7-dioxaspiro[2.5]octane-4,8-dione Chemical Properties |
| Melting point | 63-65 °C(lit.) | | Boiling point | 396.8±35.0 °C(Predicted) | | density | 1.29±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | DMF: soluble(lit.) | | form | Solid | | color | White to Off-White | | BRN | 1241835 | | InChI | InChI=1S/C8H10O4/c1-7(2)11-5(9)8(3-4-8)6(10)12-7/h3-4H2,1-2H3 | | InChIKey | AXJVPXNVESYGDT-UHFFFAOYSA-N | | SMILES | C1C2(C(=O)OC(C)(C)OC2=O)C1 | | CAS DataBase Reference | 5617-70-9(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2932209090 | | Storage Class | 11 - Combustible Solids |
| | 6,6-Dimethyl-5,7-dioxaspiro[2.5]octane-4,8-dione Usage And Synthesis |
| Uses | 6,6-Dimethyl-5,7-dioxaspiro[2.5]octan-4,8-dione is used as a reagent to synthesize Bis-benzimidazoles, compounds that act as inhibitors of Type II Dihydrofolate reductase (an enzyme that is produced by bacteria in response to Trimethoprim [T795615]as a defense mechanism). | | Synthesis Reference(s) | Organic Syntheses, Coll. Vol. 7, p. 411, 1990 The Journal of Organic Chemistry, 40, p. 2969, 1975 DOI: 10.1021/jo00908a030 |
| | 6,6-Dimethyl-5,7-dioxaspiro[2.5]octane-4,8-dione Preparation Products And Raw materials |
|