|
|
| | Biotin 4-amidobenzoic acid sodium salt Basic information |
| Product Name: | Biotin 4-amidobenzoic acid sodium salt | | Synonyms: | 4-[[5-[(3aS,4S,6aR)-Hexahydro-2-oxo-1H-thieno[3,4-d]iMidazol-4-yl]-1-oxopentyl]aMino]benzoic Acid SodiuM Salt;(+)-BIOTIN 4-AMIDOBENZOIC ACID, SODIUM SALT;SODIUM N-(+)-BIOTINYL-4-AMINOBENZOATE;N-(+)-BIOTINYL-4-AMINOBENZOIC ACID SODIUM SALT;N-BIOTINYL-P-AMINOBENZOIC ACID;N-BIOTINYL-P-AMINOBENZOIC ACID SODIUM SALT;BIOPARTICLESR FROM E. COLI K-12 TETRAMET HYLRHODAMIN;BIOTIN 4-AMIDOBENZOIC ACID SODIUM | | CAS: | 102418-74-6 | | MF: | C17H21N3O4S.Na | | MW: | 386.42 | | EINECS: | | | Product Categories: | Biotin Derivatives | | Mol File: | 102418-74-6.mol |  |
| | Biotin 4-amidobenzoic acid sodium salt Chemical Properties |
| Melting point | >300°C (dec.) | | storage temp. | 2-8°C | | solubility | Aqueous Base (Slightly), DMSO (Slightly, Heated) | | form | Solid | | color | Off-White to Pale Yellow | | Stability: | Hygroscopic | | InChIKey | AMXZKFYBAOWERX-HZPCBCDKSA-M | | SMILES | [Na+].[H][C@]12CS[C@@H](CCCCC(=O)Nc3ccc(cc3)C([O-])=O)[C@@]1([H])NC(=O)N2 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | Storage Class | 11 - Combustible Solids |
| | Biotin 4-amidobenzoic acid sodium salt Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | (+)-Biotin 4-Amidobenzoic Acid, Sodium Salt is a fluorigenic substrate for the determination of Biotinidase activity. | | General Description | Biotin 4-amidobenzoic acid is a substrate of biotinidase. |
| | Biotin 4-amidobenzoic acid sodium salt Preparation Products And Raw materials |
|