|
|
| | Tetra(4-acetylphenyl)methane Basic information |
| Product Name: | Tetra(4-acetylphenyl)methane | | Synonyms: | TETRA(4-ACETYLPHENYL)METHANE;tetrakis(4-acetylphenyl)methane;Ethanone, 1,1',1'',1'''-(methanetetrayltetra-4,1-phenylene)tetrakis-;1,1',1'',1'''-(Methanetetrayltetrakis(benzene-4,1-diyl))tetraethanone;1,1',1'',1'''-(methanetrayltetra(benzene-4,1-diyl))tetraethylone | | CAS: | 313484-93-4 | | MF: | C33H28O4 | | MW: | 488.57 | | EINECS: | | | Product Categories: | | | Mol File: | 313484-93-4.mol |  |
| | Tetra(4-acetylphenyl)methane Chemical Properties |
| Boiling point | 668.7±55.0 °C(Predicted) | | density | 1.157±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C33H28O4/c1-21(34)25-5-13-29(14-6-25)33(30-15-7-26(8-16-30)22(2)35,31-17-9-27(10-18-31)23(3)36)32-19-11-28(12-20-32)24(4)37/h5-20H,1-4H3 | | InChIKey | CAFYIOYXMUILEU-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(C(=O)C)C=C1)(C1=CC=C(C(=O)C)C=C1)(C1=CC=C(C(=O)C)C=C1)C1=CC=C(C(=O)C)C=C1 |
| | Tetra(4-acetylphenyl)methane Usage And Synthesis |
| | Tetra(4-acetylphenyl)methane Preparation Products And Raw materials |
|