|
|
| | 2',3',4',5',6'-PENTAFLUOROACETOPHENONE Basic information |
| Product Name: | 2',3',4',5',6'-PENTAFLUOROACETOPHENONE | | Synonyms: | 1-(2,3,4,5,6-Pentafluorophenyl)ethanone;Acetophenone, 2',3',4',5',6'-pentafluoro-;Ethanone, 1-(pentafluorophenyl)-;PENTAFLUOROACETOPHENONE;2',3',4',5',6'-PENTAFLUOROACETOPHENONE 97%;Pentafluoroacetophenone~99%;2',3',4',5',6'-PENTAFLUOROACETOPHENONE;2,3,4,5,6-PENTAFLUOROACETOPHENONE | | CAS: | 652-29-9 | | MF: | C8H3F5O | | MW: | 210.1 | | EINECS: | 211-487-6 | | Product Categories: | C7 to C8;Carbonyl Compounds;Ketones | | Mol File: | 652-29-9.mol |  |
| | 2',3',4',5',6'-PENTAFLUOROACETOPHENONE Chemical Properties |
| Melting point | 130.5 °C | | Boiling point | 130-131 °C(lit.) | | density | 1.476 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.4366(lit.) | | Fp | 150 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow to Light orange | | Specific Gravity | 1.476 | | BRN | 2053225 | | InChI | 1S/C8H3F5O/c1-2(14)3-4(9)6(11)8(13)7(12)5(3)10/h1H3 | | InChIKey | FBGHCYZBCMDEOX-UHFFFAOYSA-N | | SMILES | CC(=O)c1c(F)c(F)c(F)c(F)c1F | | CAS DataBase Reference | 652-29-9(CAS DataBase Reference) |
| Hazard Codes | F | | Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 3 | | Hazard Note | Flammable | | HS Code | 29147000 | | Storage Class | 10 - Combustible liquids |
| | 2',3',4',5',6'-PENTAFLUOROACETOPHENONE Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS TO YELLOW LIQUID | | Uses | 2′,3′,4′,5′,6′-Pentafluoroacetophenone was used in asymmetric synthesis of chiral alcohols using ketoreductase isolated from cyanobacterium Synechococcus sp. strain PCC 7942. It was also used in the synthesis of benzalpentafluoroacetophenone and 2,3-dihydryl-F-benzalacetophenone. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 35, p. 930, 1970 DOI: 10.1021/jo00829a013 | | General Description | Effect of magnetic field on the photochemical hydrogen abstraction of 2′,3′,4′,5′,6′-pentafluoroacetophenone in a Brij 35 micellar solution has been studied by nanosecond laser flash photolysis technique. |
| | 2',3',4',5',6'-PENTAFLUOROACETOPHENONE Preparation Products And Raw materials |
| Raw materials | ALPHA-METHYL-2,3,4,5,6-PENTAFLUOROSTYRENE-->Pentafluorobenzene-->PENTAFLUOROPHENACYL BROMIDE-->1-(PENTAFLUOROPHENYL)ETHANOL, 97-->LITHIUM TRIFLUOROACETATE-->2-(PENTAFLUOROPHENYL)-2-PROPANOL-->Acetyl chloride | | Preparation Products | 2,3,4,5,6-PENTAFLUOROSTYRENE-->Bromoethane-->4,5,6,7-Tetrafluoro-3-methyl-1-phenyl-1H-indazole |
|