- D-Citrulline
-
- $0.00 / 25Kg/Drum
-
2026-04-17
- CAS:13594-51-9
- Min. Order: 1KG
- Purity: 98%min
- Supply Ability: 500kgs
- H-D-CIT-OH
-
- $0.00 / 25KG
-
2025-06-27
- CAS:13594-51-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
- H-D-CIT-OH
-
- $1.00 / 100g
-
2019-12-24
- CAS:13594-51-9
- Min. Order: 100g
- Purity: 98%min
- Supply Ability: G/KG/T
|
| | H-D-CIT-OH Basic information |
| Product Name: | H-D-CIT-OH | | Synonyms: | (2R)-2-amino-5-(carbamoylamino)pentanoic acid;D-Citrulline >=99.0%;D-Citrulline≥ 99% (Assay);D-Orn(carbamoyl)-OH;H-D-CIT-OH;H-D-CITRULLINE;H-D-ORN(CARBAMOYL)-OH;H-D-ORN(CONH2)-OH | | CAS: | 13594-51-9 | | MF: | C6H13N3O3 | | MW: | 175.19 | | EINECS: | 211-012-2 | | Product Categories: | Amino Acids | | Mol File: | 13594-51-9.mol |  |
| | H-D-CIT-OH Chemical Properties |
| Melting point | 220-221°C | | Boiling point | 386.7±42.0 °C(Predicted) | | density | 1.289±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 2.51±0.24(Predicted) | | form | powder | | Optical Rotation | [α]20/D 20.5±2.0°, c = 2% in 1 M HCl | | BRN | 1725415 | | Major Application | peptide synthesis | | InChI | InChI=1S/C6H13N3O3/c7-4(5(10)11)2-1-3-9-6(8)12/h4H,1-3,7H2,(H,10,11)(H3,8,9,12)/t4-/m1/s1 | | InChIKey | RHGKLRLOHDJJDR-SCSAIBSYSA-N | | SMILES | C(O)(=O)[C@@H](CCCNC(N)=O)N | | CAS DataBase Reference | 13594-51-9(CAS DataBase Reference) |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | H-D-CIT-OH Usage And Synthesis |
| Chemical Properties | White powder | | Definition | ChEBI: D-citrulline is a citrulline. It is an enantiomer of a L-citrulline. | | Application | Cetrorelix (antineoplastic) | | reaction suitability | reaction type: solution phase peptide synthesis |
| | H-D-CIT-OH Preparation Products And Raw materials |
|