| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | trans-2-Aminocyclohexanol hydrochloride Basic information |
| | trans-2-Aminocyclohexanol hydrochloride Chemical Properties |
| Melting point | 172-175 °C(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble25mg/mL, clear, colorless (1N acetic acid in methanol) | | form | Crystalline Powder | | color | White or beige to light brown | | Water Solubility | soluble 25mg/mL, clear, colorless (1N acetic acid in methanol) | | Sensitive | Hygroscopic | | InChI | InChI=1/C6H13NO.ClH/c7-5-3-1-2-4-6(5)8;/h5-6,8H,1-4,7H2;1H/t5-,6-;/s3 | | InChIKey | LKKCSUHCVGCGFA-ATPDZTHWNA-N | | SMILES | [C@H]1(N)CCCC[C@@H]1O.Cl |&1:0,6,r| | | CAS DataBase Reference | 5456-63-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | WGK Germany | 3 | | HS Code | 29221985 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | trans-2-Aminocyclohexanol hydrochloride Usage And Synthesis |
| Chemical Properties | white or beige to light brown crystalline powder | | Uses | NSC 21550 is used in preparation of Benzoxazinone derivatives. |
| | trans-2-Aminocyclohexanol hydrochloride Preparation Products And Raw materials |
|