| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
(S)-N,N-Dimethyl-1-[(R)-1',2-bis(diphenylphosphino)ferrocenyl]ethylamine manufacturers
|
| | (S)-N,N-Dimethyl-1-[(R)-1',2-bis(diphenylphosphino)ferrocenyl]ethylamine Basic information |
| Product Name: | (S)-N,N-Dimethyl-1-[(R)-1',2-bis(diphenylphosphino)ferrocenyl]ethylamine | | Synonyms: | (2S)-1-[(1S)-1-(Dimethylamino)ethyl]-1',2-bis(diphenylphosphino)ferrocene;(S)-N,N-Dimethyl-1-[(R)-1',2-bis(diphenylphosphino)ferrocenyl]ethylamine,95%;(+)-(S)-N,N-Dimethyl-1-[(R)-1;(+)-(S)-N,N-Dimethyl-1-[(R)-1',2-bis(diphenylphosphino)ferrocenyl]ethylamine 95%;(+)-(S)-N,N-DIMETHYL-1-[(R)-1',2-BIS(DIPHENYLPHOSPHINO)FERROCENYL]ETHYLAMINE;(+)-(S)-N,N-dimethyl-1-((R)-1',2-bis(di-phenylpho;(S,R)-1-(1-dimethylaminoethyl)-1,2-*bis(diphenyl;(S,R)-1-(1-DIMETHYLAMINOETHYL)-1',2-BIS( DIPHENYLPH | | CAS: | 55650-59-4 | | MF: | C38H37FeNP210* | | MW: | 625.5 | | EINECS: | | | Product Categories: | Chiral Phosphine;Asymmetric Synthesis;Classes of Metal Compounds;Fe (Iron) Compounds;Ferrocenes;Metallocenes;Phosphine Ligands;Synthetic Organic Chemistry;Transition Metal Compounds;Asymmetric Synthesis;Chiral Catalysts, Ligands, and Reagents;Other Chiral Ligands | | Mol File: | 55650-59-4.mol | ![(S)-N,N-Dimethyl-1-[(R)-1',2-bis(diphenylphosphino)ferrocenyl]ethylamine Structure](CAS/GIF/55650-59-4.gif) |
| | (S)-N,N-Dimethyl-1-[(R)-1',2-bis(diphenylphosphino)ferrocenyl]ethylamine Chemical Properties |
| Melting point | 138-142 °C(lit.) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | solid | | color | Light yellow to Brown | | Optical Rotation | [α]20/D +350°, c = 0.5 in chloroform | | InChIKey | VUJPTJYMSBMZOZ-RMRYJAPISA-N | | SMILES | [Fe].[CH]1[CH][CH][C]([CH]1)P(c2ccccc2)c3ccccc3.C[C@@H]([C]4[CH][CH][CH][C]4P(c5ccccc5)c6ccccc6)N(C)C |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (S)-N,N-Dimethyl-1-[(R)-1',2-bis(diphenylphosphino)ferrocenyl]ethylamine Usage And Synthesis |
| Uses | Ligand used in the asymmetric hydrogenation of (Z)-α-amido-cinnamic acids |
| | (S)-N,N-Dimethyl-1-[(R)-1',2-bis(diphenylphosphino)ferrocenyl]ethylamine Preparation Products And Raw materials |
|