| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 2-Fluoro-6-(trifluoromethyl)benzyl bromide Basic information |
| Product Name: | 2-Fluoro-6-(trifluoromethyl)benzyl bromide | | Synonyms: | 2-Bromomethyl-3-fluorobenzotrifluoride
alpha'-Bromo-alpha,alpha,alpha,3-tetrafluoro-o-xylene;Benzene,2-(bromomethyl)-1-fluoro-3-(trifluoromethyl)-;ALPHA-BROMO-2-FLUORO-6-(TRIFLUOROMETHYL)TOLUENE;a-Bromo-2-fluoro-6-(trifluoromethyl)toluene;2-FLUORO-6-(TRIFLUOROMETHYL)BENZYL BROMI;à-bromo-2-fluoro-6-(trifluoromethyl)toluene;2-Fluoro-6-(trifluoromethyl)benzyl bromide 98%;2-Fluoro-6-(trifluoromethyl)benzylbromide98% | | CAS: | 239087-08-2 | | MF: | C8H5BrF4 | | MW: | 257.02 | | EINECS: | 627-330-3 | | Product Categories: | Fluorine series;Aryl;C8;Halogenated Hydrocarbons | | Mol File: | 239087-08-2.mol |  |
| | 2-Fluoro-6-(trifluoromethyl)benzyl bromide Chemical Properties |
| Melting point | 38-42 °C (lit.) | | Boiling point | 186℃ | | density | 1.640 | | Fp | 225 °F | | storage temp. | Inert atmosphere,Room Temperature | | solubility | soluble in Toluene | | form | powder to crystal | | color | White to Light yellow | | Sensitive | Lachrymatory | | InChI | InChI=1S/C8H5BrF4/c9-4-5-6(8(11,12)13)2-1-3-7(5)10/h1-3H,4H2 | | InChIKey | RINUERVPFANASB-UHFFFAOYSA-N | | SMILES | C1(F)=CC=CC(C(F)(F)F)=C1CBr | | CAS DataBase Reference | 239087-08-2(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-27-36/37/39 | | RIDADR | UN 1759 8/PG 3 | | WGK Germany | 3 | | Hazard Note | Corrosive/Lachrymatory | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29039990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 2-Fluoro-6-(trifluoromethyl)benzyl bromide Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | As a raw material, 2-FLUORO-6-(TRIFLUOROMETHYL)BENZYL BROMIDE involved in the synthesis of elagolix, an oral prescription medication used to manage moderate to severe pain linked to endometriosis[1]. | | References | [1] Mei, Dr. H., Han, Dr. J., Fustero, Dr. S., Medio-Simon, M., Sedgwick, D. M., Santi, Dr. C., Ruzziconi, Dr. R., & Soloshonok, Dr. V. A. (2019). Fluorine-Containing Drugs Approved by the FDA in 2018. Chemistry - A European Journal, 25 51, 11797–11819. https://doi.org/10.1002/chem.201901840 |
| | 2-Fluoro-6-(trifluoromethyl)benzyl bromide Preparation Products And Raw materials |
|