2,4,4'-TRIHYDROXYBENZOPHENONE manufacturers
|
| | 2,4,4'-TRIHYDROXYBENZOPHENONE Basic information |
| Product Name: | 2,4,4'-TRIHYDROXYBENZOPHENONE | | Synonyms: | 2,4,4'-Trihydroxybenzophenone 95%;(2,4-dihydroxyphenyl)(4-hydroxyphenyl)-methanon;2,4-Dihydroxyphenyl p-hydroxybenzyl ketone;Methanone, (2,4-dihydroxyphenyl)(4-hydroxyphenyl)-;2,4,4'-TRIHYDROXYBENZOPHENONE;(2,4-DIHYDROXY-PHENYL)-(4-HYDROXY-PHENYL)-METHANONE;LABOTEST-BB LT00159581;2,4,4-TRIHYDROXYBENZOPHENONE 98+% | | CAS: | 1470-79-7 | | MF: | C13H10O4 | | MW: | 230.22 | | EINECS: | 216-004-2 | | Product Categories: | Building Blocks;C13 to C14;Carbonyl Compounds;Chemical Synthesis;Organic Building Blocks;Benzophenones (for High-Performance Polymer Research);Functional Materials;Reagent for High-Performance Polymer Research;C13 to C14;Carbonyl Compounds;Ketones;Industrial/Fine Chemicals | | Mol File: | 1470-79-7.mol |  |
| | 2,4,4'-TRIHYDROXYBENZOPHENONE Chemical Properties |
| Melting point | 197-198 °C(lit.) | | Boiling point | 332.2°C (rough estimate) | | density | 1.2683 (rough estimate) | | refractive index | 1.4977 (estimate) | | storage temp. | RT, stored under nitrogen | | Water Solubility | Slightly soluble in water | | form | powder to crystal | | pka | 7.59±0.35(Predicted) | | color | White to Light yellow to Light orange | | InChI | 1S/C13H10O4/c14-9-3-1-8(2-4-9)13(17)11-6-5-10(15)7-12(11)16/h1-7,14-16H | | InChIKey | OKJFKPFBSPZTAH-UHFFFAOYSA-N | | SMILES | Oc1ccc(cc1)C(=O)c2ccc(O)cc2O | | CAS DataBase Reference | 1470-79-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | HS Code | 2914.50.3000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,4,4'-TRIHYDROXYBENZOPHENONE Usage And Synthesis |
| Chemical Properties | orange powder or chunks | | Uses | 2,4,4''-Trihydroxybenzophenone is a small molecule inhibitor of viral replication. | | Preparation | Preparation by reaction of 4-hydroxybenzoic acid with resorcinol,
in the presence of zinc chloride at 160° (Nencki reaction);
in the presence of zinc chloride and phosphorous oxychloride for 4 days at r.t. (78%);
in the presence of zinc chloride and a mixture of polyphosphoric acid/85% phosphoric acid (60:40) at 27°. Then, during 2 h, phosphorous trichloride was added between 27° and 37° and the mixture heated at 60° for 16 h (quantitative yield);
in the presence of hydrofluoric acid at 75° in an autoclave. |
| | 2,4,4'-TRIHYDROXYBENZOPHENONE Preparation Products And Raw materials |
|