| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4 4'-Diisothiocyanato-2 2'-stilbenedisu& Basic information |
| Product Name: | 4 4'-Diisothiocyanato-2 2'-stilbenedisu& | | Synonyms: | 4,4''-DIISOTHIOCYANATOSTILBENE-2,2''-DISULPHONIC ACID DISODIUM SALT;4,4μ-Diisothiocyanato-2,2μ-stilbenedisulfonic acid hydrate disodium salt;4,4μ-Diisothiocyanatostilbene-2,2μ-disulfonic acid hydrate disodium salt;DIDS, Disodium 4,4μ-diisothiocyanatostilbene-2,2μ-disulfonate;4,4'-Diisothiocyanatostilbene-2,2'-disulphonic acid disodium salt hydrate;Disodium 4,4'-diisothiocyanato-2,2'-stilbenedisulphonate hydrate;DisodiuM 4,4'-diisothiocyanatostilbene-2,2'-disulfonate, 4,4'-Diisothiocyanatostilbene-2,2'-disulfonic acid disodiuM salt hydrate;Disodium 4,4′-diisothiocyanatostilbene-2,2′-disulfonate | | CAS: | 207233-90-7 | | MF: | C16H13N2NaO7S4 | | MW: | 496.52 | | EINECS: | | | Product Categories: | homoXlink | | Mol File: | 207233-90-7.mol |  |
| | 4 4'-Diisothiocyanato-2 2'-stilbenedisu& Chemical Properties |
| storage temp. | 2-8°C | | solubility | 0.1 M potassium bicarbonate: soluble50mg/mL | | form | powder | | color | yellow | | BRN | 8179433 | | InChI | 1S/C16H10N2O6S4.2Na/c19-27(20,21)15-7-13(17-9-25)5-3-11(15)1-2-12-4-6-14(18-10-26)8-16(12)28(22,23)24;;/h1-8H,(H,19,20,21)(H,22,23,24);;/q;2*+1/p-2/b2-1+;; | | InChIKey | GEPAYBXVXXBSKP-SEPHDYHBSA-L | | SMILES | [Na+].[Na+].[O-]S(=O)(=O)c1cc(ccc1\C=C\c2ccc(cc2S([O-])(=O)=O)N=C=S)N=C=S |
| Hazard Codes | Xn | | Risk Statements | 36/37/38-42 | | Safety Statements | 22-26 | | WGK Germany | 3 | | HS Code | 29309090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Resp. Sens. 1
Skin Irrit. 2
STOT SE 3 |
| | 4 4'-Diisothiocyanato-2 2'-stilbenedisu& Usage And Synthesis |
| Uses | 4,4′-Diisothiocyanatostilbene-2,2′-disulfonic acid disodium salt hydrate has been used:
- as band3 protein inhibitor in rabbits(19)
- for the inhibition of bicarbonate transporters in brain slice tissue(20)
- as HCO3-/Cl- exchanger (anion exchanger) in embryos(21)
| | reaction suitability | reagent type: cross-linking reagent | | Biochem/physiol Actions | 4,4′-Diisothiocyanatostilbene-2,2′-disulfonic acid is an anionic alkylating agent containing isothiocyanate residue. It is a negatively charged homobifunctional cross-linking reagent. 4,4′-Diisothiocyanatostilbene-2,2′-disulfonic acid is a specific inhibitor of cellular anion permeability used in cell transport studies. The isothiocyanate groups react with primary amines at pH 9.0-10.0. 4,4′-Diisothiocyanatostilbene-2,2′-disulfonic acid alkylates lysine residues and inhibits apoptosis indirectly by targeting membrane based anion transporters.In addition, it also inhibits calcium transport in vesicles. |
| | 4 4'-Diisothiocyanato-2 2'-stilbenedisu& Preparation Products And Raw materials |
|