|
|
| | 4,5-Dibromo-1,2-benzenediol Basic information |
| Product Name: | 4,5-Dibromo-1,2-benzenediol | | Synonyms: | 4,5-dibromopyrocatechol;550248_SIAL;Benzen-1,2-diol, 4,5-dibromo-;NSC10858;ZINC00254871;4 5-DIBROMOBENZENE-1 2-DIOL 90% TECH;4,5-DIBROMOBENZENE-1,2-DIOL, 90% tech grade;4,5-Dibromo-1,2-Benzenediol | | CAS: | 2563-26-0 | | MF: | C6H4Br2O2 | | MW: | 267.9 | | EINECS: | | | Product Categories: | | | Mol File: | 2563-26-0.mol |  |
| | 4,5-Dibromo-1,2-benzenediol Chemical Properties |
| Melting point | 111-116°C (lit.) | | Boiling point | 328.5±37.0 °C(Predicted) | | density | 2.257±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder, crystals or chunks | | pka | 7.98±0.23(Predicted) | | Appearance | Off-white to light yellow Solid | | Major Application | diagnostic assay manufacturing hematology histology | | InChI | InChI=1S/C6H4Br2O2/c7-3-1-5(9)6(10)2-4(3)8/h1-2,9-10H | | InChIKey | IOZHUUKIHMKXRG-UHFFFAOYSA-N | | SMILES | C1(O)=CC(Br)=C(Br)C=C1O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4,5-Dibromo-1,2-benzenediol Usage And Synthesis |
| Uses | 4,5-Dibromobenzene-1,2-diol is a dye. Dyes and metabolites. | | Synthesis | 4,5-Dibromo-1,2-benzenediol is obtained by reacting catechol with Bromine in CCl4. Experimental procedure£oIn a 500mL three neck round bottom flask under nitrogen, equipped with a refluxcondenser, an addition funnel and a gas outlet connected to a bubbler filled with a 10%NaOH aqueous solution, was suspended catechol (136 mmol, 15.0 g, 1 eq.) in CCl4 (150mL). Bromine (272 mmol, 43.5 g, 2 eq.) diluted in CCla(20mL) was added dropwise at 0 over 4.5 h. The excess of bromine was neutralized with aqueous NaHSO4 (150mL,40% solution). The mixture was filtrated and the solids were dissolved in CCLa,washed with water and dried in vacuum. The obtained 4,5-dibromocatechol (30.2 g)was then recrystallized from CHCl3 (220 mL) to afford a white crystalline solid (22.5 g,62%).
 |
| | 4,5-Dibromo-1,2-benzenediol Preparation Products And Raw materials |
|