VIDARABINE (200 MG)G-2939UG/MG(AI) manufacturers
|
| | VIDARABINE (200 MG)G-2939UG/MG(AI) Basic information |
| Product Name: | VIDARABINE (200 MG)G-2939UG/MG(AI) | | Synonyms: | (2R,3S,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol hydrate;(2R,3S,4S,5R)-2-(6-aminopurin-9-yl)-5-methylol-tetrahydrofuran-3,4-diol hydrate;(2R,3S,4S,5R)-2-(6-azanylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol hydrate;Vidarabine (200 mg);Ara-A
Adenine 9-beta-D-Arabinofuranoside
9-(beta-D-Arabinofuranosyl)adenine;9-beta-d-arabinofuranosyl-9h-purin-6-aminmonohydrate;9-beta-d-arabinofuranosyl-9h-purine-6-aminemonohydrate;9-beta-d-arabinofuranosyl-adeninmonohydrate | | CAS: | 24356-66-9 | | MF: | C10H15N5O5 | | MW: | 285.2566 | | EINECS: | 678-339-4 | | Product Categories: | Antitumors for Research and Experimental Use;Antivirals for Research and Experimental Use;Biochemistry;Chemical Reagents for Pharmacology Research;Nucleosides and their analogs;Nucleosides, Nucleotides & Related Reagents | | Mol File: | 24356-66-9.mol |  |
| | VIDARABINE (200 MG)G-2939UG/MG(AI) Chemical Properties |
| Melting point | 253 °C | | Boiling point | 427.69°C (rough estimate) | | density | 1.3439 (rough estimate) | | refractive index | -3.0 ° (C=1, DMF) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | soluble in Dimethylformamide | | form | powder to crystal | | color | White to Almost white | | Water Solubility | 513.5mg/L(temperature not stated) | | Merck | 14,9976 | | InChI | 1S/C10H13N5O4.H2O/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10;/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13);1H2/t4-,6-,7+,10-;/m1./s1 | | InChIKey | ZTHWFVSEMLMLKT-CAMOTBBTSA-N | | SMILES | NC1=NC=NC2=C1N=CN2[C@@H]3O[C@@H]([C@H]([C@@H]3O)O)CO.O |
| Risk Statements | 62 | | Safety Statements | 45-53-36/37 | | WGK Germany | WGK 3 | | RTECS | AU6200000 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Repr. 2 |
| | VIDARABINE (200 MG)G-2939UG/MG(AI) Usage And Synthesis |
| Uses | Antiviral. | | Definition | A biologically active pharmaceu-
tical product having both antitumor and antiviral
properties. It was originally prepared (1959) by
chemical synthesis at Stanford Research Institute,
and later isolated from a fermentation beer of Strep-
tomyces antibioticus. | | Brand name | Vira-A (Parkdale). |
| | VIDARABINE (200 MG)G-2939UG/MG(AI) Preparation Products And Raw materials |
|