| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (3 5-Difluorophenylethynyl)trimethylsil& Basic information |
| | (3 5-Difluorophenylethynyl)trimethylsil& Chemical Properties |
| Boiling point | 200-201 °C (lit.) | | density | 0.995 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.4920(lit.) | | Fp | 167 °F | | InChI | 1S/C11H12F2Si/c1-14(2,3)5-4-9-6-10(12)8-11(13)7-9/h6-8H,1-3H3 | | InChIKey | SJTKBXIQLYSMRR-UHFFFAOYSA-N | | SMILES | C[Si](C)(C)C#Cc1cc(F)cc(F)c1 |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | (3 5-Difluorophenylethynyl)trimethylsil& Usage And Synthesis |
| | (3 5-Difluorophenylethynyl)trimethylsil& Preparation Products And Raw materials |
|