1-ETHYNYL-3 5-DIFLUOROBENZENE 97 manufacturers
|
| | 1-ETHYNYL-3 5-DIFLUOROBENZENE 97 Basic information | | Uses |
| | 1-ETHYNYL-3 5-DIFLUOROBENZENE 97 Chemical Properties |
| Boiling point | 123-124 °C (lit.) | | density | 1.163 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.4910(lit.) | | Fp | 78 °F | | storage temp. | 2-8°C | | form | liquid | | color | Colorless to Light orange to Yellow | | InChI | InChI=1S/C8H4F2/c1-2-6-3-7(9)5-8(10)4-6/h1,3-5H | | InChIKey | OTDGZDMGSFBZLI-UHFFFAOYSA-N | | SMILES | C1(C#C)=CC(F)=CC(F)=C1 |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 16-26-36 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 3 | | PackingGroup | Ⅲ | | HS Code | 2903998090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| | 1-ETHYNYL-3 5-DIFLUOROBENZENE 97 Usage And Synthesis |
| Uses | 1-ethynyl-3,5-difluorobenzene is a useful research chemical. | | Chemical Properties | light yellow liquid |
| | 1-ETHYNYL-3 5-DIFLUOROBENZENE 97 Preparation Products And Raw materials |
|