| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | ANISOLE-2,3,4,5,6-D5 Basic information |
| | ANISOLE-2,3,4,5,6-D5 Chemical Properties |
| Melting point | -37°C (lit.) | | density | 1.040 g/mL at 25 °C | | Boiling point | 154°C(lit.) | | InChI | 1S/C7H8O/c1-8-7-5-3-2-4-6-7/h2-6H,1H3/i2D,3D,4D,5D,6D | | InChIKey | RDOXTESZEPMUJZ-VIQYUKPQSA-N | | SMILES | [2H]c1c([2H])c([2H])c(OC)c([2H])c1[2H] |
| Hazard Codes | Xi | | Risk Statements | 10-36/37/38 | | Safety Statements | 16-26-36 | | RIDADR | UN 2222 3 / PGIII | | WGK Germany | 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 STOT SE 3 |
| | ANISOLE-2,3,4,5,6-D5 Usage And Synthesis |
| | ANISOLE-2,3,4,5,6-D5 Preparation Products And Raw materials |
|