|
|
| | 4-CHLOROPHENYL PHENYL-D5 ETHER Basic information |
| | 4-CHLOROPHENYL PHENYL-D5 ETHER Chemical Properties |
| Boiling point | 161-162 °C19 mm Hg(lit.) | | density | 1.222 g/mL at 25 °C | | Fp | >230 °F | | InChI | 1S/C12H9ClO/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-9H/i1D,2D,3D,4D,5D | | InChIKey | PGPNJCAMHOJTEF-RALIUCGRSA-N | | SMILES | [2H]c1c([2H])c([2H])c(Oc2ccc(Cl)cc2)c([2H])c1[2H] | | EPA Substance Registry System | 4-Chlorophenyl phenyl ether-d5 (93951-85-0) |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 |
| | 4-CHLOROPHENYL PHENYL-D5 ETHER Usage And Synthesis |
| Uses | 4-Chlorophenyl Phenyl-d5 Ether (CAS# 93951-85-0) is a useful isotopically labeled research compound. |
| | 4-CHLOROPHENYL PHENYL-D5 ETHER Preparation Products And Raw materials |
|