|
|
| | 4-BROMOPHENYL PHENYL ETHER (PHENYL-D5) Basic information |
| | 4-BROMOPHENYL PHENYL ETHER (PHENYL-D5) Chemical Properties |
| Boiling point | 305 °C(lit.) | | density | 1.451 g/mL at 25 °C | | Fp | 113 °C | | InChI | 1S/C12H9BrO/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-9H/i1D,2D,3D,4D,5D | | InChIKey | JDUYPUMQALQRCN-RALIUCGRSA-N | | SMILES | [2H]c1c([2H])c([2H])c(Oc2ccc(Br)cc2)c([2H])c1[2H] | | CAS Number Unlabeled | 101-55-3 |
| Hazard Codes | N,Xn | | Risk Statements | 50/53-43-41-22 | | Safety Statements | 60-61-36/37/39-26 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Skin Sens. 1 |
| | 4-BROMOPHENYL PHENYL ETHER (PHENYL-D5) Usage And Synthesis |
| Uses | 4-Bromophenyl Phenyl-d5 Ether (CAS# 93951-83-8) is a useful isotopically labeled research compound. |
| | 4-BROMOPHENYL PHENYL ETHER (PHENYL-D5) Preparation Products And Raw materials |
|