|
|
| | 4-Bromo-2-methylaniline Basic information |
| Product Name: | 4-Bromo-2-methylaniline | | Synonyms: | Benzenamine, 4-bromo-2-methyl-;Benzenamine, 4-bromo-2-methyl- (9CI);o-Toluidine, 4-bromo- (8CI);4-Bromo-2-methylaniline,97%;2-Amino-5-bromotoluene, 4-Bromo-o-toludine;4-broMo-2-(broMoMethyl)benzenaMine hydrobroMide;4-BroMo-2-Methylaniline, 97% 25GR;NSC 7093 | | CAS: | 583-75-5 | | MF: | C7H8BrN | | MW: | 186.05 | | EINECS: | 209-519-9 | | Product Categories: | Thiazines ,Benzothiazoles,Thiazoles;Bromine Compounds;Anilines, Amides & Amines;Anilines, Aromatic Amines and Nitro Compounds;john's | | Mol File: | 583-75-5.mol |  |
| | 4-Bromo-2-methylaniline Chemical Properties |
| Melting point | 57-59 °C(lit.) | | Boiling point | 240 °C(lit.) | | density | 1.4700 (rough estimate) | | refractive index | 1.6190 (estimate) | | Fp | >230 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 3.75±0.10(Predicted) | | color | White to Light red to Green | | BRN | 636521 | | InChI | InChI=1S/C7H8BrN/c1-5-4-6(8)2-3-7(5)9/h2-4H,9H2,1H3 | | InChIKey | PCHYYOCUCGCSBU-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(Br)C=C1C | | CAS DataBase Reference | 583-75-5(CAS DataBase Reference) | | NIST Chemistry Reference | Benzenamine, 4-bromo-2-methyl-(583-75-5) | | EPA Substance Registry System | Benzenamine, 4-bromo-2-methyl- (583-75-5) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38-33 | | Safety Statements | 26-37/39-24/25 | | RIDADR | UN2811 | | WGK Germany | 3 | | RTECS | XU4250000 | | Hazard Note | Harmful | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29214200 |
| | 4-Bromo-2-methylaniline Usage And Synthesis |
| Chemical Properties | whitetolightyellowcrystalpowde | | Uses | 4-Bromo-2-methylaniline was used in the preparation of 4-Bromo-2-methylphenol. | | Purification Methods | Steam distil the aniline and recrystallise it from EtOH. UV: max 292.5nm (H2O). [Beilstein 12 H 838, 12 I 389, 12 II 456, 12 IV 1804.] |
| | 4-Bromo-2-methylaniline Preparation Products And Raw materials |
|