Diethyl acetylmalonate manufacturers
- Diethyl acetylmalonate
-
- $2.00 / 1KG
-
2020-03-08
- CAS:570-08-1
- Min. Order: 1KG
- Purity: 99%min
- Supply Ability: 200kg
|
| | Diethyl acetylmalonate Basic information |
| Product Name: | Diethyl acetylmalonate | | Synonyms: | C-Acetylmalonic ester;Diethyl 2-acetylmalonate;Ethyl acetomalonate;Malonic acid, acetyl-, diethyl ester;AKOS MSC-0248;acetyl-propanedioic acid diethyl ester;DIETHYL ACETOMALONATE;DIETHYL ACETYLMALONATE | | CAS: | 570-08-1 | | MF: | C9H14O5 | | MW: | 202.2 | | EINECS: | | | Product Categories: | | | Mol File: | 570-08-1.mol |  |
| | Diethyl acetylmalonate Chemical Properties |
| Boiling point | 119-120°C 17mm | | density | 1.0834 | | refractive index | 1.4435 (estimate) | | Fp | 119-120°C/17mm | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform, Methanol | | form | Oil | | pka | 8.08±0.46(Predicted) | | color | Clear Colorless | | Water Solubility | Not miscible in water. | | BRN | 1781401 | | InChI | InChI=1S/C9H14O5/c1-4-13-8(11)7(6(3)10)9(12)14-5-2/h7H,4-5H2,1-3H3 | | InChIKey | SQAUUQRBOCJRCW-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(C(C)=O)C(OCC)=O | | CAS DataBase Reference | 570-08-1(CAS DataBase Reference) | | NIST Chemistry Reference | Propanedioic acid, acetyl-, diethyl ester(570-08-1) |
| Provider | Language |
|
ALFA
| English |
| | Diethyl acetylmalonate Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses | Diethyl acetylmalonate is used as pharmaceutical intermediates. |
| | Diethyl acetylmalonate Preparation Products And Raw materials |
|