- 2,6-Dichlorobenzyl bromide
-
- $100.00 / 1KG
-
2025-09-25
- CAS:20443-98-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 2,6-Dichlorobenzyl bromide Basic information |
| Product Name: | 2,6-Dichlorobenzyl bromide | | Synonyms: | alpha-Bromo-2,6-dichlorotoluene, 2-(Bromomethyl)-1,3-dichlorobenzene;2,6-two chlorobenzyl broMide;A-BROMO-2,6-DICHLOROTOLUENE;ALPHA-BROMO-2,6-DICHLOROTOLUENE;2,6-DICHLOROBENZYL BROMIDE;1-BROMOMETHYL-2,6-DICHLOROBENZENE;DICHLOROBENZYL(2,6-) BROMIDE;alpha-bromo-2,6-dichloro-toluen | | CAS: | 20443-98-5 | | MF: | C7H5BrCl2 | | MW: | 239.92 | | EINECS: | 243-827-4 | | Product Categories: | | | Mol File: | 20443-98-5.mol |  |
| | 2,6-Dichlorobenzyl bromide Chemical Properties |
| Melting point | 54-56 °C(lit.) | | Boiling point | >110°C | | density | 1.5832 (rough estimate) | | refractive index | 1.5700 (estimate) | | Fp | >230 °F | | storage temp. | Inert atmosphere,Room Temperature | | solubility | methanol: 0.1 g/mL, clear | | form | Crystals or Crystalline Powder | | color | Colorless to white | | BRN | 637351 | | InChI | InChI=1S/C7H5BrCl2/c8-4-5-6(9)2-1-3-7(5)10/h1-3H,4H2 | | InChIKey | PDFGFQUSSYSWNI-UHFFFAOYSA-N | | SMILES | C1(Cl)=CC=CC(Cl)=C1CBr | | CAS DataBase Reference | 20443-98-5(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 2-(bromomethyl)-1,3-dichloro-(20443-98-5) |
| Hazard Codes | C | | Risk Statements | 34-36/37-36 | | Safety Statements | 22-26-27-28-36/37/39-45-25 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | RTECS | XS7966000 | | F | 19 | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29039990 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B
STOT SE 3 |
| | 2,6-Dichlorobenzyl bromide Usage And Synthesis |
| Chemical Properties | White solid | | Uses | 2,6-Dichlorobenzyl Bromide is used in the preparation of potent epoxide hydrolase inhibitors. Has shown thus far to relieve hypotension in lipopolysaccharide deficient murine models. As well they have
been used in the synthesis of anti-HIV drugs based on diaryltriazine (DATA) analogues. | | Synthesis Reference(s) | Tetrahedron Letters, 29, p. 707, 1988 DOI: 10.1016/S0040-4039(00)80190-2 |
| | 2,6-Dichlorobenzyl bromide Preparation Products And Raw materials |
| Preparation Products | 2-[(2,6-DICHLOROBENZYL)OXY]BENZALDEHYDE-->2-Oxazolidinone, 3-[6-[2-[(2,6-dichlorophenyl)Methoxy]ethoxy]hexyl]-5-(2,2-diMethyl-4H-1, 3-benzodioxin-6-yl)-, (5R)--->2,6-DICHLOROBENZYL METHYL ETHER-->1-(2,6-DICHLOROBENZYL)PIPERAZINE-->5-CHLORO-1-(2,6-DICHLOROBENZYL)-1H-INDOLE-2,3-DIONE |
|