- N-Tritylglycine
-
- $1.00 / 1KG
-
2020-02-04
- CAS:5893-05-0
- Min. Order: 1KG
- Purity: Min98% HPLC
- Supply Ability: g/kg/ton
|
| | TRT-GLY-OH Basic information |
| | TRT-GLY-OH Chemical Properties |
| Melting point | 172-174°C | | Boiling point | 480.0±33.0 °C(Predicted) | | density | 1.178±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | almost transparency in Methanol | | pka | 2.14±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | BRN | 1998718 | | Major Application | peptide synthesis | | InChI | 1S/C21H19NO2/c23-20(24)16-22-21(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15,22H,16H2,(H,23,24) | | InChIKey | XUXRXWLKUYPGMZ-UHFFFAOYSA-N | | SMILES | OC(=O)CNC(c1ccccc1)(c2ccccc2)c3ccccc3 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2922.49.4950 | | Storage Class | 11 - Combustible Solids |
| | TRT-GLY-OH Usage And Synthesis |
| Chemical Properties | White powder | | Uses | N-protected glycine for the preparation of peptides. | | reaction suitability | reaction type: solution phase peptide synthesis |
| | TRT-GLY-OH Preparation Products And Raw materials |
|