| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-Cyclohepten-1yl boronic acid pinacol ester Basic information |
| Product Name: | 1-Cyclohepten-1yl boronic acid pinacol ester | | Synonyms: | 1,3,2-Dioxaborolane, 2-(1-cyclohepten-1-yl)-4,4,5,5-tetramethyl-;2-(Cyclohept-1-en-1-yl)-4,4,5,5-tetraMethyl-1,3,2-dioxaborolane;1-Cyclohepten-1yl boronic acid pinacol ester;1-Cycloheptene-1-boronic Acid Pinacol Ester;2-(cyclohepten-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;(Z )-2-Cycloheptenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;1-Cyclohepten-1-Boronic Acid Pinacol Ester;1-Cycloheptenylboronic acid pinacol ester | | CAS: | 287944-13-2 | | MF: | C13H23BO2 | | MW: | 222.13 | | EINECS: | | | Product Categories: | Alkyl;Organoborons | | Mol File: | 287944-13-2.mol |  |
| | 1-Cyclohepten-1yl boronic acid pinacol ester Chemical Properties |
| Boiling point | 253.0±33.0 °C(Predicted) | | density | 0.94±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | solid | | InChI | 1S/C13H23BO2/c1-12(2)13(3,4)16-14(15-12)11-9-7-5-6-8-10-11/h9H,5-8,10H2,1-4H3 | | InChIKey | XCKJXFSLFZYWSB-UHFFFAOYSA-N | | SMILES | CC1(C)OB(OC1(C)C)C2=CCCCCC2 |
| WGK Germany | WGK 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 1-Cyclohepten-1yl boronic acid pinacol ester Usage And Synthesis |
| | 1-Cyclohepten-1yl boronic acid pinacol ester Preparation Products And Raw materials |
|