| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- 2-Dimethylaminopyridine
-
- $1.10
-
2025-06-25
- CAS:5683-33-0
- Min. Order: 1g
- Purity: 99.0% min
- Supply Ability: 100 tons min
|
| | 2-Dimethylaminopyridine Basic information |
| | 2-Dimethylaminopyridine Chemical Properties |
| Melting point | 182°C | | Boiling point | 191 °C(lit.) | | density | 0.984 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.559(lit.) | | Fp | 167 °F | | storage temp. | Store below +30°C. | | pka | 7.04±0.10(Predicted) | | form | Liquid | | color | Clear colorless to pale yellow | | Water Solubility | Soluble in water. | | BRN | 110353 | | InChI | InChI=1S/C7H10N2/c1-9(2)7-5-3-4-6-8-7/h3-6H,1-2H3 | | InChIKey | PSHKMPUSSFXUIA-UHFFFAOYSA-N | | SMILES | C1(N(C)C)=NC=CC=C1 | | CAS DataBase Reference | 5683-33-0(CAS DataBase Reference) | | NIST Chemistry Reference | N,N-Dimethyl-2-pyridinamine(5683-33-0) |
| Hazard Codes | Xi,T | | Risk Statements | 36/37/38-34-23/24/25 | | Safety Statements | 23-26-36-45-36/37/39-27 | | RIDADR | 1993 | | WGK Germany | 3 | | RTECS | US9200000 | | F | 10 | | HazardClass | 3 | | PackingGroup | II | | HS Code | 29333999 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| | 2-Dimethylaminopyridine Usage And Synthesis |
| Chemical Properties | Clear colorless to pale yellow liquid | | Uses | 2-(Dimethylamino)pyridine in toluene at room temperature in the presence of 1.1 equivalent of methyl trifluoromethanesulfonate forms (2-pyridyl)-trimethylammonium trifluoromethanesulfonate salt. It is used as a model substrate in the preparation of chelate carbene via cyclometalation, H2 loss and reversible α-elimination. | | General Description | 2-(Dimethylamino)pyridine is a clear, colorless to light yellow liquid. | | Safety Profile | A poison by
intravenous route. When heated to
decomposition it emits toxic vapors of NOx |
| | 2-Dimethylaminopyridine Preparation Products And Raw materials |
|