|
|
| | 2-Phenylethyl-beta-D-thiogalactoside Basic information |
| Product Name: | 2-Phenylethyl-beta-D-thiogalactoside | | Synonyms: | PHENYLETHYL-B-D-THIO-GALACTOSIDE;2-Phenylethyl 1-thio-beta-D-galactoside;Phenethyl β-D-thiogalactoside;2-phenylethyl β-d-thiogalactoside;Phenylethylb-D-thiogalactopyranoside;2-PHENYLETHYL SS-D-THIOGALACTOSIDE;PETG, Phenethyl β-D-thiogalactoside;Phenylethyl β-D-thiogalactopyranoside | | CAS: | 63407-54-5 | | MF: | C14H20O5S | | MW: | 300.37 | | EINECS: | | | Product Categories: | | | Mol File: | 63407-54-5.mol |  |
| | 2-Phenylethyl-beta-D-thiogalactoside Chemical Properties |
| Melting point | 100 °C | | Boiling point | 539.7±50.0 °C(Predicted) | | density | 1.39±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | methanol: 50 mg/mL, clear, colorless | | pka | 12.99±0.70(Predicted) | | form | Solid | | color | White to off-white | | Optical Rotation | [α]/D -33.00 to -27.00°, c =9.00-11.00 mg/mL in methanol | | BRN | 20033 | | InChI | InChI=1/C14H20O5S/c15-8-10-11(16)12(17)13(18)14(20-10)19-7-6-9-4-2-1-3-5-9/h1-5,10-18H,6-8H2/t10-,11+,12+,13-,14-/s3 | | InChIKey | RXWGJLGIKBAPBK-YEDZMODINA-N | | SMILES | [C@H]1(OCCC2C=CC=CC=2)[C@H](O)[C@H]([C@@H](O)[C@@H](CO)S1)O |&1:0,10,12,13,15,r| |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 3-10 | | HS Code | 29329900 | | Storage Class | 11 - Combustible Solids |
| | 2-Phenylethyl-beta-D-thiogalactoside Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | 2-Phenylethyl β-D-thiogalactoside has been used in a study to assess subnanoliter enzymatic assays on microarrays. It has also been used in a study that investigated the integration of on-column immobilized enzyme reactor in microchip electrophoresis. | | General Description | 2-Phenylethyl β-D-thiogalactoside is a cell-permable inhibitor of the reporter enzyme β-galactosidase. | | Purification Methods | Recrystallise the thiogalactoside from H2O and dry in air to give the 1.5.H2O which has m 80o. The anhydrous surfactant is obtained by drying it at 78o over P2O5. [Heilfrich & Türk Chem Ber 89 2215 1856.] |
| | 2-Phenylethyl-beta-D-thiogalactoside Preparation Products And Raw materials |
|