| Company Name: |
Vijaya Pharma And Life Science
|
| Tel: |
+91-8939866271 |
| Email: |
drbala@vijayapharmalifescience.com |
| Products Intro: |
Product Name:Citalopram hydrochloride
CAS:85118-27-0
Purity:98% Package:1 kg,5 kg, 10 kg,25kg and 1 MT
|
|
| | Citalopram hydrochloride Basic information |
| Product Name: | Citalopram hydrochloride | | Synonyms: | 1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-1,3-dihydro-5-isobenzofurancarbonitrile hydrochloride;1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile,hydrochloride;citalopram hydrochloride;1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-1,3-dihydroisobenzofuran-5-carbonitrile monohydrochloride;1-(3-(Dimethylamino)propyl)-1-(4-fluorophenyl)-1,3-dihydroisobenzofuran-5-carbonitrile monohydrochloride;Einecs 285-680-9;Citalopram hydrochloride CRS;Citalopram hydrochloride salt | | CAS: | 85118-27-0 | | MF: | C20H22ClFN2O | | MW: | 360.8528832 | | EINECS: | 285-680-9 | | Product Categories: | | | Mol File: | 85118-27-0.mol |  |
| | Citalopram hydrochloride Chemical Properties |
| storage temp. | 2-8°C | | solubility | Very soluble in water, freely soluble in anhydrous ethanol. | | Stability: | Hygroscopic | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C20H21FN2O.ClH/c1-23(2)11-3-10-20(17-5-7-18(21)8-6-17)19-9-4-15(13-22)12-16(19)14-24-20;/h4-9,12H,3,10-11,14H2,1-2H3;1H | | InChIKey | FXSXPIKCGLXHAW-UHFFFAOYSA-N | | SMILES | Fc1ccc(cc1)C2(OCc3c2ccc(c3)C#N)CCCN(C)C.[Cl-].[H+] |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 3
Repr. 2
STOT SE 3 |
| | Citalopram hydrochloride Usage And Synthesis |
| Chemical Properties | White or almost white, crystalline powder. | | Uses | Citalopram Hydrochloride is a salt of Citalopram, an anti-depressant drug. | | Uses | Selective serotonin reuptake inhibitor; antidepressant. |
| | Citalopram hydrochloride Preparation Products And Raw materials |
|