|
|
| | 2-chloro-2-5-dihydroxyacetophenone Basic information |
| Product Name: | 2-chloro-2-5-dihydroxyacetophenone | | Synonyms: | 2-chloro-2-5-dihydroxyacetophenone;2-chloro-1-(2,5-dihydroxyphenyl)ethanone;Ethanone, 2-chloro-1-(2,5-dihydroxyphenyl)- (9CI);ETHANONE,2-CHLORO-1-(2,5-DIHYDROXYPHENYL)-;α-chloro-2,5-dihydroxyacetophenone;2-Chloro-1-(2,5-dihydroxyphenyl)ethan-1-one;α-Chloro-2',5'-dihydroxyacetophenone;Noradrenaline (Norepinephrine) Impurity 19 | | CAS: | 60912-82-5 | | MF: | C8H7ClO3 | | MW: | 186.59 | | EINECS: | | | Product Categories: | ACETYLHALIDE | | Mol File: | 60912-82-5.mol |  |
| | 2-chloro-2-5-dihydroxyacetophenone Chemical Properties |
| Melting point | 113-115 °C | | Boiling point | 376.1±32.0 °C(Predicted) | | density | 1.444±0.06 g/cm3(Predicted) | | pka | 8.24±0.43(Predicted) | | InChI | InChI=1S/C8H7ClO3/c9-4-8(12)6-3-5(10)1-2-7(6)11/h1-3,10-11H,4H2 | | InChIKey | LBQJAEBXOIEKLM-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC(O)=CC=C1O)CCl |
| | 2-chloro-2-5-dihydroxyacetophenone Usage And Synthesis |
| Uses | α-Chloro-2'',5''-dihydroxyacetophenone acts as a reagent for the design, synthesis and cytotoxic activity of 5-hydroxyaurone derivatives as growth inhibitors against HUVEC and some cancer cell lines. Also in chemopreventive and antioxidant activity of 6-substituted imidazo[2,1-b]thiazoles |
| | 2-chloro-2-5-dihydroxyacetophenone Preparation Products And Raw materials |
|