6-Cyanopyridine-2-carboxylic acid manufacturers
|
| | 6-Cyanopyridine-2-carboxylic acid Basic information |
| | 6-Cyanopyridine-2-carboxylic acid Chemical Properties |
| Boiling point | 376.9±27.0 °C(Predicted) | | density | 1.42±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 3.08±0.10(Predicted) | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C7H4N2O2/c8-4-5-2-1-3-6(9-5)7(10)11/h1-3H,(H,10,11) | | InChIKey | NDFGHOYJWGPBEH-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)=NC(C#N)=CC=C1 |
| | 6-Cyanopyridine-2-carboxylic acid Usage And Synthesis |
| Synthesis | 6-Carbamoylpyridine-2-carboxylic acid (compound G1) (500 mg, 3 mmol) was mixed with phosphoryl chloride (POCl3) (15 mL) and heated to reflux temperature for 2 hours. After completion of the reaction, the reaction mixture was processed according to conventional methods, and the resulting crude product could be used for subsequent reactions without further purification. Yield: 280 mg (63%), melting point: 180-181 °C. | | References | [1] Patent: WO2006/589, 2006, A1. Location in patent: Page/Page column 57-58
[2] Patent: EP2533783, 2015, B1. Location in patent: Paragraph 0451-0452 |
| | 6-Cyanopyridine-2-carboxylic acid Preparation Products And Raw materials |
|