- TROXACITABINE
-
- $1.00
-
2020-01-05
- CAS: 145918-75-8
- Min. Order: 1KG
- Purity: 95--99%
- Supply Ability: 1ton
|
| | TROXACITABINE Basic information |
| Product Name: | TROXACITABINE | | Synonyms: | TROXACITABINE;TROXACITABINE,2(1H)-PYRIMIDINONE, 4-AMINO-1-(2-(HYDROXYMETHYL)-1,3-DIOXOLAN-4-YL)-, (2S-CIS)-;4-Amino-1-[(2S)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]pyrimidin-2-one;(-)-Bch 204;CS-150;Lamivudine Impurity I
(Troxacitabine);4-amino-1-[(2S,4S)-2-(hydroxymethyl)-1,3-dioxolan-4-yl]-1,2-dihydropyrimidin-2-one;(-)-Occc | | CAS: | 145918-75-8 | | MF: | C8H11N3O4 | | MW: | 213.19 | | EINECS: | 200-258-5 | | Product Categories: | | | Mol File: | 145918-75-8.mol |  |
| | TROXACITABINE Chemical Properties |
| Melting point | 176-177° | | alpha | D25 -38.33° (c = 0.43 in MeOH). | | Boiling point | 422.5±55.0 °C(Predicted) | | density | 1.71±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 14.83±0.10(Predicted) | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | InChI=1S/C8H11N3O4/c9-5-1-2-11(8(13)10-5)6-4-14-7(3-12)15-6/h1-2,6-7,12H,3-4H2,(H2,9,10,13)/t6-,7-/m0/s1 | | InChIKey | RXRGZNYSEHTMHC-BQBZGAKWSA-N | | SMILES | C1(=O)N([C@@H]2CO[C@H](CO)O2)C=CC(N)=N1 |
| | TROXACITABINE Usage And Synthesis |
| Uses | Troxacitabine is a nucleoside analogue with potential anticancer activity. Troxacitabine have been studied in patients with refractory lymphoproliferative diseases. | | Definition | ChEBI: Troxacitabine is a nucleobase-containing molecular entity and a carbohydrate derivative. | | in vivo | Troxacitabine is highly active against the Panc-01 model, with TGI levels of 88.5% and 84.3% at the 10 and 25 mg/kg doses, respectively. The mean final tumor weights for animals given troxacitabine are also significantly smaller compared with vehicle controls. Troxacitabine has less activity against the MiaPaCa model[3]. Troxacitabine is very effective in human RCC tumor xenograft models, including CAM-i, A498, RXF-393, and SN12C carcinomas. Very good responses are ob served in animals bearing CAM-i, A498, and RXF-393 RCC tumors given i.p. doses of 10, 25, and 50 mg/kg twice a day for 5 days[2]. |
| | TROXACITABINE Preparation Products And Raw materials |
|