|
|
| | ETHYL ORANGE Basic information |
| Product Name: | ETHYL ORANGE | | Synonyms: | RESAZURINE REDOX INDICATOR;EthylorangeAcs98%;EthylOrangeSodium;Ethylorange Acs 98%;Ethyl Orange sodium salt, pure, 92%;Ethyl orange sodium salt, 92%, pure;Ethyl Orange sodium salt,4-(4-Diethylaminophenylazo)benzenesulfonic acid sodium salt;Ethyl Orange sodiuM salt, pure, 92% 25GR | | CAS: | 62758-12-7 | | MF: | C16H20N3NaO3S | | MW: | 357.4 | | EINECS: | 263-716-4 | | Product Categories: | Organics;Analytical Chemistry;Indicator (pH);pH Indicators;Azo | | Mol File: | 62758-12-7.mol |  |
| | ETHYL ORANGE Chemical Properties |
| Melting point | >300°C | | storage temp. | room temp | | solubility | Very soluble in water; very slightly soluble in ethanol | | pka | 4.34(at 25℃) | | form | Powder | | color | Orange | | PH Range | Red (3.4) to yellow (4.8) | | Water Solubility | H2O: 1mg/mL | | ε(extinction coefficient) | ≥29000 at 473-477nm in deionized water
≥8000 at 274-282nm in deionized water | | λmax | 474nm | | BRN | 3821641 | | Major Application | Lithographic plate preparation, holographic storage, hybrid materials, inks, surface probes, diagnostic agents for diseases related with amyloid accumulation | | InChI | InChI=1S/C16H19N3O3S.Na.H/c1-3-19(4-2)15-9-5-13(6-10-15)17-18-14-7-11-16(12-8-14)23(20,21)22;;/h5-12H,3-4H2,1-2H3,(H,20,21,22);;/b18-17+;; | | InChIKey | JIQMFPYPPUEBQO-QIKYXUGXSA-N | | SMILES | N(C1C=CC(/N=N/C2C=CC(S(O)(=O)=O)=CC=2)=CC=1)(CC)CC.[NaH] | | CAS DataBase Reference | 62758-12-7(CAS DataBase Reference) | | EPA Substance Registry System | Benzenesulfonic acid, 4-[[4-(diethylamino)phenyl]azo]-, sodium salt (62758-12-7) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29270000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | ETHYL ORANGE Usage And Synthesis |
| Chemical Properties | orange crystalline powder | | Uses | Indicator: pH 3.0 (red) to pH 4.5 (yellow) | | Purification Methods | Recrystallise it twice from water. [Beilstein 16 IV 511.] |
| | ETHYL ORANGE Preparation Products And Raw materials |
|