| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 2,2,2-Trifluoro-2',4',6'-trimethylacetophenone Basic information |
| Product Name: | 2,2,2-Trifluoro-2',4',6'-trimethylacetophenone | | Synonyms: | 2,2,2-Trifluoro-1-(2,4,6-trimethyl-phenyl)-ethanone;2,2,2-Trifluoro-1-mesitylethanone;Ethanone, 2,2,2-trifluoro-1-(2,4,6-trimethylphenyl)- (9CI);2,2,2-Trifluoro-2',4',6'-trimethylacetophenone 97%;2,2,2-Trifluoro-2',4',6'-trimethylacetophenone97%;2,2,2-Trifluoro-1-(2,4,6-trimethylphenyl)ethan-1-one, 2-(Trifluoroacetyl)mesitylene;Ethanone, 2,2,2-trifluoro-1-(2,4,6-trimethylphenyl)-;2,2,2-Trifluoro-2',4',6'-trimethylacetophenone | | CAS: | 313-56-4 | | MF: | C11H11F3O | | MW: | 216.2 | | EINECS: | | | Product Categories: | ACETYLHALIDE;C11 to C12;Carbonyl Compounds;Ketones;Building Blocks;C11 to C12;Carbonyl Compounds;Chemical Synthesis;Organic Building Blocks | | Mol File: | 313-56-4.mol |  |
| | 2,2,2-Trifluoro-2',4',6'-trimethylacetophenone Chemical Properties |
| Boiling point | 70-80 °C20 mm Hg(lit.) | | density | 1.136 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.456(lit.) | | Fp | 170 °F | | form | liquid | | InChI | 1S/C11H11F3O/c1-6-4-7(2)9(8(3)5-6)10(15)11(12,13)14/h4-5H,1-3H3 | | InChIKey | VINRTVDNUHIWCB-UHFFFAOYSA-N | | SMILES | Cc1cc(C)c(c(C)c1)C(=O)C(F)(F)F |
| Hazard Codes | Xi,F | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 2914790090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,2,2-Trifluoro-2',4',6'-trimethylacetophenone Usage And Synthesis |
| Uses | 2,2,2-Trifluoro-2′,4′,6′-trimethylacetophenone may be used for organic synthesis. |
| | 2,2,2-Trifluoro-2',4',6'-trimethylacetophenone Preparation Products And Raw materials |
|