| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-Formyl-piperidine-4-carboxylic acid Basic information | | Uses |
| | 1-Formyl-piperidine-4-carboxylic acid Chemical Properties |
| Melting point | 137-138°C | | Boiling point | 377.8±35.0 °C(Predicted) | | density | 1.350±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 4.44±0.20(Predicted) | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C7H11NO3/c9-5-8-3-1-6(2-4-8)7(10)11/h5-6H,1-4H2,(H,10,11) | | InChIKey | IZNTWTMLHCGAJU-UHFFFAOYSA-N | | SMILES | N1(C=O)CCC(C(O)=O)CC1 |
| | 1-Formyl-piperidine-4-carboxylic acid Usage And Synthesis |
| Uses | 1-Aldehydepiperidine-4-carboxylic acid is used as an intermediate in organic synthesis and pharmaceuticals (such as risperidone). |
| | 1-Formyl-piperidine-4-carboxylic acid Preparation Products And Raw materials |
|