Tetraethylammonium nitrate manufacturers
|
| | Tetraethylammonium nitrate Basic information |
| Product Name: | Tetraethylammonium nitrate | | Synonyms: | TETRAETHYLAMMONIUM NITRATE;TETRAETHYLAMMONIUM NITRATE, 35 WT. % SOL UTION IN WATER, 99.999%;TETRAETHYLAMMONIUM NITRATE, ELECTRO-CHEM ICAL GRADE;TETRAETHYLAMMONIUM NITRATE, 35% AQUEOUS;n,n,n-triethyl-ethanaminiunitrate;Tetraethylammonium nitrate, 35% w/w aq. soln.;Tetraethylammonium nitrate solution;Ethanaminium, N,N,N-triethyl-, nitrate | | CAS: | 1941-26-0 | | MF: | C8H20N2O3 | | MW: | 192.26 | | EINECS: | 217-725-5 | | Product Categories: | | | Mol File: | 1941-26-0.mol |  |
| | Tetraethylammonium nitrate Chemical Properties |
| Melting point | ~280 °C (dec.) | | Boiling point | >100 °C | | density | 1.029 g/mL at 25 °C | | refractive index | 1.4450 (estimate) | | Fp | >100°C | | storage temp. | Storage temp. 2-8°C | | solubility | acetonitrile: 0.1 g/mL, clear, colorless | | form | Crystalline Powder | | color | White | | Specific Gravity | 1.029 | | BRN | 3918466 | | Stability: | Stable. Incompatible with reducing agents, combustible materials, strong oxidants. Strong oxidizer - contact with combustible material may lead to fire. | | InChI | 1S/C8H20N.NO3/c1-5-9(6-2,7-3)8-4;2-1(3)4/h5-8H2,1-4H3;/q+1;-1 | | InChIKey | JTJKNAJRGLQKDZ-UHFFFAOYSA-N | | SMILES | [O-][N+]([O-])=O.CC[N+](CC)(CC)CC | | EPA Substance Registry System | Ethanaminium, N,N,N-triethyl-, nitrate (1941-26-0) |
| Hazard Codes | Xi,O | | Risk Statements | 8-36/37/38 | | Safety Statements | 26-36-17 | | RIDADR | UN 3139 5.1/PG 3 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 5.1 | | PackingGroup | III | | HS Code | 29239000 | | Storage Class | 5.1B - Oxidizing hazardous materials | | Hazard Classifications | Eye Irrit. 2 Ox. Sol. 2 Skin Irrit. 2 STOT SE 3 |
| | Tetraethylammonium nitrate Usage And Synthesis |
| Chemical Properties | white or off-white solid | | Uses | Tetraethylammonium nitrate can be used:
- To prepare nitronium triflate by reacting with triflic anhydride for subsequent use as a nitrating agent for benzene.
- To study the dependency of luminescence intensity of Eu3+complexes on the nitrate anion concentration.
- To prepare the lanthanum(III) complex named (NEt4)[La(ntfa)4] by reacting with La(NO3)3·6H2O, NaOH and 4,4,4-trifluoro-1-(2-naphthyl)-1,3-butanedion.
|
| | Tetraethylammonium nitrate Preparation Products And Raw materials |
|