| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | tert-Butyl N-(4-iodophenyl)carbamate Basic information |
| Product Name: | tert-Butyl N-(4-iodophenyl)carbamate | | Synonyms: | N-(tert-Butoxycarbonyl)-4-iodoaniline;N-BOC-4-IODOANILINE;TERT-BUTYL 4-IODOPHENYLCARBAMATE;(4-Iodophenyl)carbamic acid tert-butyl ester;N-(4-iodophenyl)carbamic acid tert-butyl ester;Carbamic acid, N-(4-iodophenyl)-, 1,1-dimethylethyl ester;ert-Butyl(4-iodophenyl)carbamate;N-Boc-4-iodoaniline | | CAS: | 159217-89-7 | | MF: | C11H14INO2 | | MW: | 319.14 | | EINECS: | | | Product Categories: | | | Mol File: | 159217-89-7.mol |  |
| | tert-Butyl N-(4-iodophenyl)carbamate Chemical Properties |
| Melting point | 144-148 °C | | Boiling point | 299.0±23.0 °C(Predicted) | | density | 1.591±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | solid | | pka | 13.12±0.70(Predicted) | | Appearance | White to off-white Solid | | Sensitive | Light Sensitive | | InChI | 1S/C11H14INO2/c1-11(2,3)15-10(14)13-9-6-4-8(12)5-7-9/h4-7H,1-3H3,(H,13,14) | | InChIKey | CGALRQWBJFDAKN-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)Nc1ccc(I)cc1 |
| Hazard Codes | Xn,N | | Risk Statements | 22-43-50 | | Safety Statements | 36/37-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | HS Code | 2924297099 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Skin Sens. 1 |
| | tert-Butyl N-(4-iodophenyl)carbamate Usage And Synthesis |
| Synthesis | GENERAL STEPS: The reaction was carried out in a 50 mL round-bottomed flask at 80°C under reduced pressure for 10 minutes. In a typical experiment, 5 mmol of p-iodoaniline was mixed with 5 mmol of di-tert-butyl dicarbonate and the reaction lasted for 10 minutes. Upon completion of the reaction, the solvent was removed by rotary evaporator under vacuum to give tert-butyl (4-iodophenyl)carbamate. | | References | [1] Bioorganic and Medicinal Chemistry Letters, 2006, vol. 16, # 22, p. 5864 - 5869
[2] Research on Chemical Intermediates, 2017, vol. 43, # 3, p. 1355 - 1363
[3] Chemical Communications, 2013, vol. 49, # 61, p. 6909 - 6911
[4] Patent: WO2004/12736, 2004, A1. Location in patent: Page/Page column 24
[5] Organic Letters, 2018, vol. 20, # 7, p. 1693 - 1697 |
| | tert-Butyl N-(4-iodophenyl)carbamate Preparation Products And Raw materials |
|