| Company Name: |
Selectoprobe Gold |
| Tel: |
15156792748 |
| Email: |
li_kang@selectoprobe.com |
|
| | Potassium tetrakis(4-chlorophenyl)borate Basic information | | Uses |
| | Potassium tetrakis(4-chlorophenyl)borate Chemical Properties |
| Melting point | >300°C | | solubility | Soluble in chloroform. | | form | powder to crystaline | | color | White to Almost white | | Sensitive | Hygroscopic | | BRN | 4117827 | | InChI | 1S/C24H16BCl4.K/c26-21-9-1-17(2-10-21)25(18-3-11-22(27)12-4-18,19-5-13-23(28)14-6-19)20-7-15-24(29)16-8-20;/h1-16H;/q-1;+1 | | InChIKey | SAGICZRAKJSWLD-UHFFFAOYSA-N | | SMILES | [K+].Clc1ccc(cc1)[B-](c2ccc(Cl)cc2)(c3ccc(Cl)cc3)c4ccc(Cl)cc4 | | CAS DataBase Reference | 14680-77-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | UN2811 | | WGK Germany | 3 | | HazardClass | 6.1 | | HS Code | 29319090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | Potassium tetrakis(4-chlorophenyl)borate Usage And Synthesis |
| Uses | Potassium Tetrakis(4-chlorophenyl)borate [Anion for the neutral carrier type ion electrode] (cas# 14680-77-4) is a useful research chemical. | | Uses | Potassium tetrakis(4-chlorophenyl)borate is used as lipophilic anionic site in constructing fluorescent optode for sodium. It was also used as coating for the piezoelectric crystal in quantifying Potassium using quartz crystal microbalance. |
| | Potassium tetrakis(4-chlorophenyl)borate Preparation Products And Raw materials |
|