|
|
| | Phenol, 4,4',4'',4'''-(1,2-ethenediylidene)tetrakis- Basic information |
| Product Name: | Phenol, 4,4',4'',4'''-(1,2-ethenediylidene)tetrakis- | | Synonyms: | Tetrakis(4-hydroxyphenyl)ethylene;tetrakis(4-hydroxytetraphenyl)ethene;Phenol, 4,4',4'',4'''-(1,2-ethenediylidene)tetrakis-;Tetrakis(4-hydroxyphenyl)ethene;4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetraphenol;tetra(p-hydroxyphenyl)ethylene;4-[1,2,2-tris(4-hydroxyphenyl)ethenyl]phenol;4,4',4'',4'''-(1,2-ethenediylidene)tetrakis-phenol | | CAS: | 119301-59-6 | | MF: | C26H20O4 | | MW: | 396.43 | | EINECS: | | | Product Categories: | | | Mol File: | 119301-59-6.mol |  |
| | Phenol, 4,4',4'',4'''-(1,2-ethenediylidene)tetrakis- Chemical Properties |
| Melting point | 323°C(lit.) | | Boiling point | 559.4±45.0 °C(Predicted) | | density | 1.324±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | solid | | pka | 9.72±0.26(Predicted) | | color | White to Light yellow to Light red | | InChI | InChI=1S/C26H20O4/c27-21-9-1-17(2-10-21)25(18-3-11-22(28)12-4-18)26(19-5-13-23(29)14-6-19)20-7-15-24(30)16-8-20/h1-16,27-30H | | InChIKey | QQUZHNPGWNIYMK-UHFFFAOYSA-N | | SMILES | C(/C1=CC=C(O)C=C1)(\C1=CC=C(O)C=C1)=C(\C1=CC=C(O)C=C1)/C1=CC=C(O)C=C1 |
| WGK Germany | WGK 3 | | HS Code | 2907.29.9000 | | Storage Class | 11 - Combustible Solids |
| | Phenol, 4,4',4'',4'''-(1,2-ethenediylidene)tetrakis- Usage And Synthesis |
| Uses | TPE-TOH is a synthetic intermediate of aggregation-induced emission (AIE) dye for use in further synthesis of alkyl-halogen to make ether via esterification and polymer reaction. |
| | Phenol, 4,4',4'',4'''-(1,2-ethenediylidene)tetrakis- Preparation Products And Raw materials |
|