|
|
| | 2,2-Diethoxyacetophenone Basic information |
| Product Name: | 2,2-Diethoxyacetophenone | | Synonyms: | 2,2-Dimethoxyacetophenone;DiethoxyAcetophenone;2，2-Diethoxyacetophone;Ethanone, 2,2-diethoxy-1-phenyl-;α,α-Diethoxyacetophenone, Phenylglyoxal 2-diethyl acetal;Glyoxal, phenyl-, 2-(diethyl acetal)-;1-Phenyl-2,2-bis(ethoxy)ethanone;1-Phenyl-2,2-diethoxyethan-1-one | | CAS: | 6175-45-7 | | MF: | C12H16O3 | | MW: | 208.25 | | EINECS: | 228-220-4 | | Product Categories: | Functional Materials;Photopolymerization Initiators | | Mol File: | 6175-45-7.mol |  |
| | 2,2-Diethoxyacetophenone Chemical Properties |
| Boiling point | 131-134 °C/10 mmHg (lit.) | | density | 1.034 g/mL at 25 °C (lit.) | | vapor pressure | 0.01 mm Hg ( 20 °C) | | refractive index | n20/D 1.499(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,2-8°C | | form | Liquid | | Specific Gravity | 1.034 | | color | Clear yellow | | Water Solubility | 0.16 g/L (25 ºC) | | BRN | 2100306 | | InChI | InChI=1S/C12H16O3/c1-3-14-12(15-4-2)11(13)10-8-6-5-7-9-10/h5-9,12H,3-4H2,1-2H3 | | InChIKey | PIZHFBODNLEQBL-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=CC=C1)C(OCC)OCC | | CAS DataBase Reference | 6175-45-7(CAS DataBase Reference) | | EPA Substance Registry System | Ethanone, 2,2-diethoxy-1-phenyl- (6175-45-7) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-33-40 | | Safety Statements | 23-24/25-36 | | WGK Germany | 3 | | RTECS | MD3284000 | | TSCA | TSCA listed | | HS Code | 29145090 | | Storage Class | 10 - Combustible liquids |
| | 2,2-Diethoxyacetophenone Usage And Synthesis |
| Chemical Properties | clear yellow to salmon liquid | | Uses | It is an effective photoinitiator for UV-curable acrylate-based coatings, adhesives and inks. used in UV-curable system. Particularly useful for photo curing clear acrylate-based formulations where non-yellowing is important. It is also recommended for pigmented inks where shelf life and color stability are essential. |
| | 2,2-Diethoxyacetophenone Preparation Products And Raw materials |
|