| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (S,S)-I-Pr-duphos Basic information | | Reaction |
| Product Name: | (S,S)-I-Pr-duphos | | Synonyms: | (-)-1,2-BIS((2S,5S)-2,5-DI-I-PROPYLPHOSPHOLANO)BENZENE;(-)-1,2-BIS((2S,5S)-2,5-DIISOPROPYLPHOSPHOLANO)BENZENE;(-)-1,2-Bis[(2S,5S)-2,5-diisopropylphospholano]benzene, Kanata purity;(-)-1,2-Bis((2S,5S)-2,5-di-i-propylphospholano)benzene,98+%(S,S)-i-Pr-DUPHOS;(-)-1,2-Bis((2S,5S)-2,5-di-i-propylphospholano)benzene (S,S)-i-Pr-DUPHOS;1,2-bis((2S,5S)-2,5-diisopropylphospholan-1-yl)benzene;1,2-Bis[(2S,5S)-2,5-diisopropyl-1-phospholanyl]benzene, 97+%;Phospholane, 1,1'-(1,2-phenylene)bis[2,5-bis(1-methylethyl)-, (2S,2'S,5S,5'S)- | | CAS: | 147253-69-8 | | MF: | C26H44P2 | | MW: | 418.58 | | EINECS: | | | Product Categories: | organophosphine ligand | | Mol File: | 147253-69-8.mol |  |
| | (S,S)-I-Pr-duphos Chemical Properties |
| Melting point | 40°C | | alpha | -85° (c 1, hexane) | | Boiling point | 502.0±20.0 °C(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | crystal | | color | white | | Sensitive | Air Sensitive | | InChI | 1S/C26H44P2/c1-17(2)21-13-14-22(18(3)4)27(21)25-11-9-10-12-26(25)28-23(19(5)6)15-16-24(28)20(7)8/h9-12,17-24H,13-16H2,1-8H3/t21-,22-,23-,24-/m0/s1 | | InChIKey | RBVGOQHQBUPSGX-ZJZGAYNASA-N | | SMILES | CC(C)[C@@H]1CC[C@@H](C(C)C)P1c2ccccc2P3[C@@H](CC[C@H]3C(C)C)C(C)C |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | (S,S)-I-Pr-duphos Usage And Synthesis |
| Reaction |
- The DUPHOS family of catalysts is highly efficient for the asymmetric hydrogenation of various substituted acetamidoacrylates and enol acetates yielding products of high enantiomeric excesses. Efficient ligand for the asymmetric hydrogenation of tetrasubstituted enamides.
- Forms superior catalysts for asymmetric reductive aminations.
- Catalyst used for the asymmetric hydrogenation of enol phosphonates.
- A novel enantioselective synthesis of β-amino alcohols and 1,2-diamines.
- Ligand for the catalytic asymmetric [4+1] cycloaddition of vinylallenes with CO.
- Ligand for the Rh-catalyzed asymmetric enyne cycloisomerization.
- Catalytic enantioselective addition of dialkylzinc to N-Diphenylphosphinoylimines.
- Palladium catalyzed asymmetric phosphination.
- Catalytic enantioselective allylation of ketones.
- Enantioselective synthesis of cyclopropylborates.
- Ligand used in gold catalyzed rearrangement of cyclopropylidene.



| | Uses | DuPhos and BPE Ligands: Highly Efficient Privileged Ligands |
| | (S,S)-I-Pr-duphos Preparation Products And Raw materials |
|