- Mexidole
-
- $0.00 / 1Kg/Bag
-
2026-02-13
- CAS:127464-43-1
- Min. Order: 1KG
- Purity: 99%min
- Supply Ability: 10 TONS
- mexidol
-
- $10.00 / 1KG
-
2026-01-30
- CAS:127464-43-1
- Min. Order: 100KG
- Purity: 99%
- Supply Ability: 100 mt
- Emoxypine Succinate
-
- $29.00 / 1mL
-
2026-01-13
- CAS:127464-43-1
- Min. Order:
- Purity: 99.58%
- Supply Ability: 10g
|
| | mexidol Basic information |
| Product Name: | mexidol | | Synonyms: | mexidol;2-Ethyl-6-methyl-3-pyridinol butanoate (1:1);2-Ethyl-6-methyl-3-hydroxypyridine succinate;Butanedioic acid 2-ethyl-6-methyl-3-pyridinol (1:1);Mexidole (2-ethyl-6-Methyl-3-hydroxypyridine succinate);2-Ethyl-6-Methylpyridin-3-ol succinate;2-ethyl-6-Methyl-3-hydroxypyridine succinate (Mexidole);2-Ethyl-6-Methyl-3-pyridinol butanoate | | CAS: | 127464-43-1 | | MF: | C8H11NO.C4H6O4 | | MW: | 255.268 | | EINECS: | 811-046-3 | | Product Categories: | | | Mol File: | 127464-43-1.mol |  |
| | mexidol Chemical Properties |
| Melting point | 119-120 °C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C8H11NO.C4H6O4/c1-3-7-8(10)5-4-6(2)9-7;5-3(6)1-2-4(7)8/h4-5,10H,3H2,1-2H3;1-2H2,(H,5,6)(H,7,8) | | InChIKey | IKMNOGHPKNFPTK-UHFFFAOYSA-N | | SMILES | C1(CC)N=C(C=CC=1O)C.C(C(=O)O)CC(=O)O |
| | mexidol Usage And Synthesis |
| Uses | The Chinese name of Mesidol is 2-ethyl-6methyl-3-hydroxypyridine succinic acid (Mexidox), 2-ethyl-6-methyl-3-hydroxypyridine succinate (emoxypine, product Name-MEXIDOL, etc.) is widely used in medicine as an antioxidant and anti-hypoxic agent. Use 2-ethyl-6-methyl-3-hydroxypyridine succinate as a nootropic and anxiolytic, anti-ischemic and atherosclerotic, anti-angina, liver protection, antibacterial, etc. | | Preparation | 3.5 liters of ethanol, 1.2 kg of 2-ethyl-6-methyl-3-hydroxypyridine and 1.0 kg of succinic acid were added to the reactor. The reaction mass is heated to the boiling point of ethanol (78°C) and stirring is continued for 20 minutes until the components are completely dissolved. Then, keep the reaction mass in the reactor under stirring until the temperature reaches 20°C, cool to 5°C and keep at this temperature for 16 hours, stirring occasionally. The suspension is then stirred until the material is homogeneous, overloaded in a centrifuge and filtered. The precipitate of the succinate salt of 2-ethyl-6-methyl-3-hydroxypyridine was dried to constant weight in a vacuum oven at 45°C. The yield of the target product 2-ethyl-6-methyl-3-hydroxypyridine succinate (Mexitrad) was 89%. | | in vivo | Emoxypine succinate (i.p.; 40 mg/kg; 1 time per day, 14 days) decreases the production of reactive oxygen species, mitochondrial transmembrane potential percentage of leukocyte and the percentage of FITC Annexin V- positive cells of leukocyte suspension[1]. | Animal Model: | Rats[1] | | Dosage: | 40 mg/kg | | Administration: | Intraperitoneal, 1 time per day, 14 days | | Result: | Significantly increased the percentage of Annexin V-positive cells, reduced the apoptotic percentage of white blood cells and decreased the production of reactive oxygen species by leukocytes. |
|
| | mexidol Preparation Products And Raw materials |
|