| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | (S)-N-Boc-3-Amino-3-phenylpropanoic acid Basic information |
| | (S)-N-Boc-3-Amino-3-phenylpropanoic acid Chemical Properties |
| Melting point | 122.9 °C | | Boiling point | 408.52°C (rough estimate) | | density | 1.1356 (rough estimate) | | refractive index | 1.5110 (estimate) | | storage temp. | 2-8°C | | pka | 4.32±0.10(Predicted) | | Appearance | White to off-white Solid | | Major Application | peptide synthesis | | InChI | 1S/C14H19NO4/c1-14(2,3)19-13(18)15-11(9-12(16)17)10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3,(H,15,18)(H,16,17)/t11-/m0/s1 | | InChIKey | JTNQFJPZRTURSI-NSHDSACASA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](CC(O)=O)c1ccccc1 | | CAS DataBase Reference | 103365-47-5(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 29242990 | | Storage Class | 13 - Non Combustible Solids |
| Provider | Language |
|
ACROS
| English |
| | (S)-N-Boc-3-Amino-3-phenylpropanoic acid Usage And Synthesis |
| Chemical Properties | white chunks | | Uses | (S)-3-Phenyl-3-(tert-butoxycarbonylamino)propanoic Acid, is an unnatural amino acid derivative. It can be used for the synthesis of Carnosine (C184190), derivatives as selective and efficient sequestering agents of cytotoxic reactive carbonyl species. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | (S)-N-Boc-3-Amino-3-phenylpropanoic acid Preparation Products And Raw materials |
|