- 3,6'-Disinapoyl sucrose
-
- $0.00 / 10mg
-
2025-12-16
- CAS:139891-98-8
- Min. Order: 10mg
- Purity: 95%+
- Supply Ability: 10000000
- 3,6′-Disinapoyl sucrose
-
- $0.00 / 20mg
-
2023-02-24
- CAS:139891-98-8
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | (3-sinapoyl)fructofuranosyl-(6-sinapoyl)glucopyranoside Basic information |
| Product Name: | (3-sinapoyl)fructofuranosyl-(6-sinapoyl)glucopyranoside | | Synonyms: | (3-sinapoyl)fructofuranosyl-(6-sinapoyl)glucopyranoside;1)-alpha-D-[6-O-sinapoyl]-glucopyranoside;beta-D-(3-O-Sinapoyl)-fructofuranosyl-(2-1)-alpha-D-[6-O-sinapoyl]-glucopyranoside;Disinapoyl Sucrose, 3,6'-;3,6’-Disinapoyl sucrose;c3,6’-Disinapoyl sucrose;3,6'-Disinapoyl sucr | | CAS: | 139891-98-8 | | MF: | C34H42O19 | | MW: | 754.69 | | EINECS: | | | Product Categories: | | | Mol File: | 139891-98-8.mol |  |
| | (3-sinapoyl)fructofuranosyl-(6-sinapoyl)glucopyranoside Chemical Properties |
| Melting point | 129-130℃ | | Boiling point | 988.0±65.0 °C(Predicted) | | density | 1.56±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in DMSO and methan | | pka | 9.75±0.36(Predicted) | | form | powder | | color | Beige | | Major Application | metabolomics vitamins, nutraceuticals, and natural products | | InChIKey | SJMPGYOOYSOPLD-KUCTVCKGNA-N | | SMILES | OC1=C(OC)C=C(/C=C/C(O[C@@H]2[C@@](O[C@@H]3[C@H](O)[C@@H](O)[C@H](O)[C@@H](COC(/C=C/C4=CC(OC)=C(O)C(OC)=C4)=O)O3)(CO)O[C@H](CO)[C@H]2O)=O)C=C1OC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | (3-sinapoyl)fructofuranosyl-(6-sinapoyl)glucopyranoside Usage And Synthesis |
| Chemical Properties | White crystalline powder, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from Polygala tenuifolia. | | Uses | c3,6’-Disinapoylsucrose is a useful research chemical compound with antidepressant like effects on hippocampal neuronal plasticity and neurotrophic signal pathway in chronic mild stress. | | Biological Activity | 3,6μ-Disinapoylsucrose is a major active component of traditional Chinese medicine. It has significant effects on neuroprotection and improving learning memory. |
| | (3-sinapoyl)fructofuranosyl-(6-sinapoyl)glucopyranoside Preparation Products And Raw materials |
|