|
|
| | Ethyl 1-hydroxy-1H-1,2,3-triazole-4-carboxylate Basic information |
| Product Name: | Ethyl 1-hydroxy-1H-1,2,3-triazole-4-carboxylate | | Synonyms: | 1-Hydroxy-1H-1,2,3-triazole-5-carboxylic acid ethyl ester;HOCT [Ethyl 1-hydroxy-1H-1,2,3-triazole-4-carboxylate];REF DUPL: HOCT;Ethyl 1-hydroxy-1H-1;Ethyl 1-hydroxy-1H-1,2,3-triazole-4-carboxylate;Ethyl 1-Hydroxy-1,2,3-triazole-4-carboxylate;1-Hydroxy-1H-1,2,3-triazole-4-carboxylic Acid Ethyl Ester;1-hydroxy-4-triazolecarboxylate | | CAS: | 137156-41-3 | | MF: | C5H7N3O3 | | MW: | 157.13 | | EINECS: | | | Product Categories: | | | Mol File: | 137156-41-3.mol |  |
| | Ethyl 1-hydroxy-1H-1,2,3-triazole-4-carboxylate Chemical Properties |
| Melting point | 105 °C | | Boiling point | 339.1±34.0 °C(Predicted) | | density | 1.49 | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 6.10±0.58(Predicted) | | color | White to Off-White | | InChI | InChI=1S/C5H7N3O3/c1-2-11-5(9)4-3-8(10)7-6-4/h3,10H,2H2,1H3 | | InChIKey | FIRHQRGFVOSDDY-UHFFFAOYSA-N | | SMILES | N1(O)C=C(C(OCC)=O)N=N1 | | CAS DataBase Reference | 137156-41-3(CAS DataBase Reference) |
| | Ethyl 1-hydroxy-1H-1,2,3-triazole-4-carboxylate Usage And Synthesis |
| Uses | ethyl 1-hydroxy-1H-1,2,3-triazole-4-carboxylate (HOCt) is an optimal coupling reagent used for solid phase peptide synthesis in Fmoc chemistry. It is used in combination with carbodiimide reagents, has very high coupling efficiency, and does not absorb at 302nm, thus allowing real-time monitoring of each coupling cycle in SPPS. | | References | [1] Jiang, L., Davison, A., Tennant, G., & Ramage, R. (1998). Synthesis and application of a novel coupling reagent, ethyl 1-hydroxy-1H -1,2,3-triazole-4-carboxylate. Tetrahedron, 54 47, Pages 14233-14254. https://doi.org/10.1016/S0040-4020(98)00876-X
|
| | Ethyl 1-hydroxy-1H-1,2,3-triazole-4-carboxylate Preparation Products And Raw materials |
|